release: v0.9.3

fix: inline code corrupted in table (#27 )
docs: update README.md
2025-06-23 00:01:17 -04:00 · 2020-10-07 18:46:06 +08:00 · 2020-10-07 18:41:45 +08:00 · 2020-10-03 09:22:31 +08:00 · 2020-09-18 12:35:17 +08:00 · 2020-09-16 18:40:38 +08:00
26 changed files with 1876 additions and 542 deletions
--- a/.codeclimate.yml
+++ b/.codeclimate.yml
@ -0,0 +1,38 @@
+version: "2"
+checks:
+  argument-count:
+    enabled: true
+    config:
+      threshold: 5
+  file-lines:
+    enabled: true
+    config:
+      threshold: 300
+  method-complexity:
+    enabled: true
+    config:
+      threshold: 15
+  method-count:
+    enabled: true
+    config:
+      threshold: 50
+  method-lines:
+    enabled: true
+    config:
+      threshold: 30
+plugins:
+  fixme:
+    enabled: false
+
+exclude_patterns:
+  - "*.*"
+  - ".*"
+
+  - Gemfile
+  - LICENSE.txt
+  - Rakefile
+
+  - rake/
+  - script/
+  - spec/
+  - test/
--- a/.github/FUNDING.yml
+++ b/.github/FUNDING.yml
@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: # Replace with up to 4 GitHub Sponsors-enabled usernames e.g., [user1, user2]
+patreon: jeffreytse
+open_collective: # Replace with a single Open Collective username
+ko_fi: jeffreytse
+tidelift: # Replace with a single Tidelift platform-name/package-name e.g., npm/babel
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: jeffreytse
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
--- a/.rspec
+++ b/.rspec
@ -0,0 +1,3 @@
+--color
+--format progress
+--require spec_helper
--- a/.travis.yml
+++ b/.travis.yml
@ -1,7 +1,7 @@
 language: ruby
 cache: bundler
 rvm:
-  - &latest_ruby 2.7
+  - 2.7
  - 2.3
 env:
  global:
@ -10,10 +10,10 @@ env:
    - JEKYLL_VERSION="~> 3.8"
 matrix:
  include:
-    - rvm: *latest_ruby
-      env: JEKYLL_VERSION="~> 3.8.6"
-    - rvm: *latest_ruby
-      env: JEKYLL_VERSION=">= 4.0.0"
+  - rvm: 2.7
+    env: JEKYLL_VERSION="~> 3.8.6"
+  - rvm: 2.7
+    env: JEKYLL_VERSION=">= 4.0.0"
 before_install:
  - gem update --system
  - gem install bundler
@ -21,3 +21,14 @@ before_script: bundle update
 script: script/cibuild
 notifications:
  email: false
+deploy:
+  provider: rubygems
+  api_key:
+    secure: AqjHemFJsIxFuudjWzYbUGBpA5wpAB9Ate6oDZMGMnpaoSD2VgfkBDklyFfEh5uuHrh+rU6U9MPv4wknXVIV7gTTY18ATgzciLa+JCVjhAaSoPGSkORT15/kKpVp4IXIoEytj5T9D+8Wc8czd/B1+lMGGu7n7d7gMvg0HsjOLzJtAOYPrRUTaTXDLeIA+rPnsI1IzbvfHzcZvuD70XkBJWN9kiu0djlI6o51XQNumWMJrFAD/NDD3h3tZ0kkI0TalAYbWVRkZ/ZeABKAod3IRAXGt4L2MM2eYqE5KaXb/GE5wISib3I/iTCjjwrNlM+wM9a+mnOkC+elaCJm1LENqP5Ocy9wbOLYmC8i1VpPDXm2bskbj32oy1wf5zeQUf6bnPB+wDmwgCirYb7z2jQlV4BzRRkDCTftfNTa8FIi03kf+i7phjHuj18j/JC3Ww1ApRq71JAuqEnUY0wBaaN3M5abrJsYOxCRnYVPcBn/w8gfkXuhv9xvDG2OgwqIjDiECPjmbeK8Apo9kgKSrfjBQ43q62Ore6SuVCS+PZOOxVnHmfphfT4xc1atyVeMLkSvnWOa/sWTwgOSXqt1TYAEEhb734AsfXeRMzxU/LN1Y4nZ0otuEv+HVHA/XeHLA1Skq9vHhtZaORhJ58Jmwv5oMwA8KC/wPrn0gGtSBPe8zxw=
+  gem: jekyll-spaceship
+  on:
+    rvm: 2.3
+    tags: true
+    repo: jeffreytse/jekyll-spaceship
+  edge: true
+  cleanup: false
--- a/README.md
+++ b/README.md
@ -1,16 +1,99 @@
-# jekyll-spaceship
+<h1 align="center">
+  <a href="https://github.com/jeffreytse/jekyll-spaceship">
+    <img alt="spaceship →~ jekyll" src="https://raw.githubusercontent.com/jeffreytse/jekyll-spaceship/master/logos/jekyll-spaceship-logo.png" width="400">
+  </a>
+  <br> 🚀 Jekyll Spaceship 🚀 <br>
+</h1>

-[![Build Status](https://travis-ci.org/jeffreytse/jekyll-spaceship.svg?branch=master)](https://travis-ci.org/jeffreytse/jekyll-spaceship)
-[![Gem Version](https://badge.fury.io/rb/jekyll-spaceship.svg)](http://badge.fury.io/rb/jekyll-spaceship)
-[![Code Climate](https://codeclimate.com/github/jeffreytse/jekyll-spaceship/badges/gpa.svg)](https://codeclimate.com/github/jeffreytse/jekyll-spaceship)
-[![Test Coverage](https://api.codeclimate.com/v1/badges/cd56b207f327603662a1/test_coverage)](https://codeclimate.com/github/jeffreytse/jekyll-spaceship/test_coverage)
+<h4 align="center">
+  <a href="https://jekyllrb.org" target="_blank"><code>Jekyll</code></a> plugin for Astronauts.
+</h4>
+
+<p align="center">
+
+  <a href="https://travis-ci.org/jeffreytse/jekyll-spaceship">
+    <img src="https://travis-ci.org/jeffreytse/jekyll-spaceship.svg?branch=master"
+      alt="CI Status" />
+  </a>
+
+  <a href="http://badge.fury.io/rb/jekyll-spaceship">
+    <img src="https://badge.fury.io/rb/jekyll-spaceship.svg"
+      alt="Gem Version" />
+  </a>
+
+  <a href="https://codeclimate.com/github/jeffreytse/jekyll-spaceship">
+    <img src="https://codeclimate.com/github/jeffreytse/jekyll-spaceship/badges/gpa.svg"
+      alt="Code Climate" />
+  </a>
+
+  <a href="https://codeclimate.com/github/jeffreytse/jekyll-spaceship/test_coverage">
+    <img src="https://api.codeclimate.com/v1/badges/cd56b207f327603662a1/test_coverage"
+      alt="Test Coverage" />
+  </a>
+
+  <a href="https://github.com/jeffreytse/jekyll-spaceship/blob/master/LICENSE.txt">
+    <img src="https://img.shields.io/badge/License-MIT-brightgreen.svg"
+      alt="License" />
+  </a>
+
+  <a href="http://badge.fury.io/rb/jekyll-spaceship">
+    <img src="https://img.shields.io/gem/dt/jekyll-spaceship"
+      alt="Download Data" />
+  </a>
+
+</p>
+
+<p align="center">
+
+  <a href="https://liberapay.com/jeffreytse">
+    <img src="http://img.shields.io/liberapay/goal/jeffreytse.svg?logo=liberapay"
+      alt="Donate (Liberapay)" />
+  </a>
+
+  <a href="https://patreon.com/jeffreytse">
+    <img src="https://img.shields.io/badge/support-patreon-F96854.svg?style=flat-square"
+      alt="Donate (Patreon)" />
+  </a>
+
+  <a href="https://ko-fi.com/jeffreytse">
+    <img height="20" src="https://www.ko-fi.com/img/githubbutton_sm.svg"
+      alt="Donate (Ko-fi)" />
+  </a>
+
+</p>
+
+<div align="center">
+  <h4>
+    <a href="#installation">Install</a> |
+    <a href="#configuration">Config</a> |
+    <a href="#usage">Usage</a> |
+    <a href="#credits">Credits</a> |
+    <a href="#license">License</a>
+  </h4>
+</div>
+
+<div align="center">
+  <sub>Built with ❤︎ by
+  <a href="https://jeffreytse.net">jeffreytse</a> and
+  <a href="https://github.com/jeffreytse/jekyll-spaceship/graphs/contributors">contributors </a>
+</div>
+<br>
+
+
+Spaceship is a minimalistic, powerful and extremely customizable [Jekyll](https://jekyllrb.com/) plugin. It combines everything you may need for convenient work, without unnecessary complications, like a real spaceship.
+
+<p align="center">
+    <img alt="Jekyll Spaceship Demo" src="https://user-images.githubusercontent.com/9413601/82250463-15451780-997e-11ea-8809-f411586d9508.gif" />
+</p>
+
+**💡 Tip:** I hope you enjoy using this plugin. If you like this project, **a little star** for it is your way make a clear statement: **My work is valued**. I would appreciate your support! _Thank you!_

-A Jekyll plugin to provide powerful supports for table, mathjax, plantuml, youtube, etc.

 ## Table of Contents

 - [Requirements](#requirements)
 - [Installation](#installation)
+- [Configuration](#configuration)
 - [Usage](#usage)
  - [1. Table Usage](#1-table-usage)
    - [1.1 Rowspan and Colspan](#rowspan-and-colspan)
@ -18,15 +101,26 @@ A Jekyll plugin to provide powerful supports for table, mathjax, plantuml, youtu
    - [1.3 Headerless](#headerless)
    - [1.4 Cell Alignment](#cell-alignment)
    - [1.5 Cell Markdown](#cell-markdown)
+    - [1.6 Cell Inline Attributes](#cell-inline-attributes)
  - [2. MathJax Usage](#2-mathjax-usage)
+    - [2.1 Performance Optimization](#21-performance-optimization)
+    - [2.2 How to use?](#22-how-to-use)
  - [3. PlantUML Usage](#3-plantuml-usage)
-  - [4. Video Usage](#4-video-usage)
-    - [4.1 Youtube Usage](#youtube-usage)
-    - [4.2 Vimeo Usage](#vimeo-usage)
-    - [4.3 DailyMotion Usage](#dailymotion-usage)
-  - [5. Hybrid HTML with Markdown](#5-hybrid-html-with-markdown)
-  - [6. Markdown Polyfill](#6-markdown-polyfill)
-    - [6.1 Escape Ordered List](#escape-ordered-list)
+  - [4. Mermaid Usage](#4-mermaid-usage)
+  - [5. Media Usage](#5-media-usage)
+    - [5.1 Youtube Usage](#youtube-usage)
+    - [5.2 Vimeo Usage](#vimeo-usage)
+    - [5.3 DailyMotion Usage](#dailymotion-usage)
+    - [5.4 Spotify Usage](#spotify-usage)
+    - [5.5 SoundCloud Usage](#soundcloud-usage)
+    - [5.6 General Video Usage](#general-video-usage)
+    - [5.7 General Audio Usage](#general-audio-usage)
+  - [6. Hybrid HTML with Markdown](#6-hybrid-html-with-markdown)
+  - [7. Markdown Polyfill](#7-markdown-polyfill)
+    - [7.1 Escape Ordered List](#71-escape-ordered-list)
+  - [8. Emoji Usage](#8-emoji-usage)
+    - [8.1 Emoji Customizing](#81-emoji-customizing)
+  - [9. Modifying Element Usage](#9-modifying-element-usage)
 - [Credits](#credits)
 - [Contributing](#contributing)
 - [License](#license)
@ -43,13 +137,81 @@ Add jekyll-spaceship plugin in your site's `Gemfile`, and run `bundle install`.
 gem 'jekyll-spaceship'
 ```

-Add jekyll-spaceship to the `gems:` section in your site's `_config.yml`.
+Add jekyll-spaceship to the `plugins:` section in your site's `_config.yml`.

 ```yml
 plugins:
  - jekyll-spaceship
 ```

+**💡 Tip:** Note that GitHub Pages runs in `safe` mode and only allows [a set of whitelisted plugins](https://pages.github.com/versions/). To use the gem in GitHub Pages, you need to build locally or use CI (e.g. [travis](https://travis-ci.org/), [github workflow](https://help.github.com/en/actions/configuring-and-managing-workflows/configuring-a-workflow)) and deploy to your `gh-pages` branch.
+
+### Additions for Unlimited GitHub Pages
+
+* Here is a GitHub Action named [jekyll-deploy-action](https://github.com/jeffreytse/jekyll-deploy-action) for Jekyll site deployment conveniently. 👍
+* Here is a [Jekyll site](https://github.com/jeffreytse/jekyll-jeffreytse-blog) using Travis to build and deploy to GitHub Pages for your references.
+
+## Configuration
+
+This plugin runs with the following configuration options by default. Alternative settings for these options can be explicitly specified in the configuration file `_config.yml`.
+
+```yml
+# Where things are
+jekyll-spaceship:
+  # default enabled processors
+  processors:
+    - table-processor
+    - mathjax-processor
+    - plantuml-processor
+    - mermaid-processor
+    - polyfill-processor
+    - media-processor
+    - emoji-processor
+    - element-processor
+  mathjax-processor:
+    src:
+      - https://polyfill.io/v3/polyfill.min.js?features=es6
+      - https://cdn.jsdelivr.net/npm/mathjax@3/es5/tex-mml-chtml.js
+    config:
+      tex:
+        inlineMath:
+          - ['$','$']
+          - ['\(','\)']
+      svg:
+        fontCache: 'global'
+  plantuml-processor:
+    mode: default  # mode value 'pre-fetch' for fetching image at building stage
+    css:
+      class: plantuml
+    syntax:
+      code: 'plantuml!'
+      custom: ['@startuml', '@enduml']
+    src: http://www.plantuml.com/plantuml/svg/
+  mermaid-processor:
+    mode: default  # mode value 'pre-fetch' for fetching image at building stage
+    css:
+      class: mermaid
+    syntax:
+      code: 'mermaid!'
+      custom: ['@startmermaid', '@endmermaid']
+    config:
+      theme: default
+    src: https://mermaid.ink/svg/
+  media-processor:
+    default:
+      id: 'media-{id}'
+      class: 'media'
+      width: '100%'
+      height: 350
+      frameborder: 0
+      style: 'max-width: 600px; outline: none;'
+      allow: 'encrypted-media; picture-in-picture'
+  emoji-processor:
+    css:
+      class: emoji
+    src: https://github.githubassets.com/images/icons/emoji/
+```
+
 ## Usage

 ### 1. Table Usage
@ -72,13 +234,13 @@ This feature is contributed by [pmccloghrylaing](https://github.com/pmccloghryla
 ```markdown
 |              Stage | Direct Products | ATP Yields |
 | -----------------: | --------------: | ---------: |
-|         Glycolysis |           2 ATP |            |
-|                 ^^ |          2 NADH |   3--5 ATP |
+|         Glycolysis |          2 ATP              ||
+| ^^                 |          2 NADH |   3--5 ATP |
 | Pyruvaye oxidation |          2 NADH |      5 ATP |
 |  Citric acid cycle |          2 ATP              ||
-|                 ^^ |          6 NADH |     15 ATP |
-|                 ^^ |          2 FADH |      3 ATP |
-|                                   30--32 ATP    |||
+| ^^                 |          6 NADH |     15 ATP |
+| ^^                 |          2 FADH |      3 ATP |
+|                               30--32 ATP        |||
 ```

 Code above would be parsed as:
@ -279,7 +441,7 @@ Table cell can be set alignment separately.
 ```markdown
 | :        Fruits \|\| Food       : |||
 | :--------- | :-------- | :--------  |
-| Apple      | :  Apple :| Apple      \
+| Apple      | : Apple : | Apple      \
 | Banana     |   Banana  | Banana     \
 | Orange     |   Orange  | Orange     |
 | :   Rowspan is 4    : || How's it?  |
@ -380,11 +542,66 @@ Rowspan is 4
 </tbody>
 </table>

+#### Cell Inline Attributes
+
+This feature is very useful for custom cell such as using inline style. (e.g., background, color, font)  
+The idea and syntax comes from the [Maruku](http://maruku.rubyforge.org/) package.  
+
+[](https://kramdown.gettalong.org/syntax.html#block-ials)
+
+Following are some examples of attributes definitions (ALDs) and afterwards comes the syntax explanation:
+
+```markdown
+{:ref-name: #id .cls1 .cls2}
+{:second: ref-name #id-of-other title="hallo you"}
+{:other: ref-name second}
+```
+
+An ALD line has the following structure:
+
+- a left brace, optionally preceded by up to three spaces,
+- followed by a colon, the id and another colon,
+- followed by attribute definitions (allowed characters are backslash-escaped closing braces or any character except a not escaped closing brace),
+- followed by a closing brace and optional spaces until the end of the line.
+
+If there is more than one ALD with the same reference name, the attribute definitions of all the ALDs are processed like they are defined in one ALD.
+
+An inline attribute list (IAL) is used to attach attributes to another element.  
+Here are some examples for span IALs:
+
+```markdown
+{: #id .cls1 .cls2} <!-- #id <=> id="id", .cls1 .cls2 <=> class="cls1 cls2" -->
+{: ref-name title="hallo you"}
+{: ref-name class='.cls3' .cls4}
+```
+
+Here is an example for custom table cell with IAL:
+
+```markdown
+{:color-style: style="background: black;"}
+{:color-style: style="color: white;"}
+{:text-style: style="font-weight: 800; text-decoration: underline;"}
+
+|:             Here's an Inline Attribute Lists example                :||||
+| ------- | ------------------ | -------------------- | ------------------ |
+|:       :|:  <div style="color: red;"> &lt; Normal HTML Block > </div> :|||
+| ^^      |   Red    {: .cls style="background: orange" }                |||
+| ^^ IALs |   Green  {: #id style="background: green; color: white" }    |||
+| ^^      |   Blue   {: style="background: blue; color: white" }         |||
+| ^^      |   Black  {: color-style text-style }                         |||
+```
+
+Code above would be parsed as:
+
+<img width="580px" src="https://user-images.githubusercontent.com/9413601/88461592-738afb00-ced7-11ea-9aac-3179023742b0.png" alt="IALs">
+
+Additionally, [here](https://kramdown.gettalong.org/syntax.html#block-ials) you can learn more details about IALs.
+
 ### 2. MathJax Usage

 [MathJax](http://www.mathjax.org/) is an open-source JavaScript display engine for LaTeX, MathML, and AsciiMath notation that works in all modern browsers.

-**Some of the main features of MathJax include:**
+Some of the main features of MathJax include:

 - High-quality display of LaTeX, MathML, and AsciiMath notation in HTML pages
 - Supported in most browsers with no plug-ins, extra fonts, or special
@ -394,6 +611,12 @@ Rowspan is 4
  advanced functionality
 - Powerful API for integration with other web applications

+#### 2.1 Performance optimization
+
+At building stage, the MathJax engine script will be added by automatically checking whether there is a math expression in the page, this feature can help you improve the page performance  on loading speed.
+
+#### 2.2 How to use?
+
 Put your math expression within \$...\$

 ```markdown
@ -408,22 +631,26 @@ $ 2^{\frac{n-1}{3}} $
 $ \int\_a^b f(x)\,dx. $
 ```

+Code above would be parsed as:
+
+<image alt="MathJax Expression" height="180" src="https://user-images.githubusercontent.com/9413601/82814245-5a5ed180-9ec9-11ea-9d5b-fba303c627ac.png"></image>
+
 ### 3. PlantUML Usage

-[PlantUML](http://plantuml.sourceforge.net/) is a component that allows to quickly write:
+[PlantUML](https://plantuml.com) is a component that allows to quickly write:

 - sequence diagram,
 - use case diagram,
 - class diagram,
 - activity diagram,
 - component diagram,
- state diagram
+- state diagram,
 - object diagram

 There are two ways to create a diagram in your Jekyll blog page:

-````markdown
-```plantuml
+````
+```plantuml!
 Bob -> Alice : hello world
 ```
 ````
@ -436,24 +663,76 @@ Bob -> Alice : hello
@enduml
 ```

-### 4. Video Usage
+Code above would be parsed as:

-How often did you find yourself googling "**How to embed a video in markdown?**"
+![PlantUML Diagram](https://user-images.githubusercontent.com/9413601/82813883-9180b300-9ec8-11ea-8778-f450e0056938.png)

-While its not possible to embed a video in markdown, the best and easiest way is to extract a frame from the video. To add videos to your markdown files easier I developped this tool for you, and it will parse the video link inside the image block automatically.
+### 4. Mermaid Usage

-**For now, these video links parsing are provided:**
+[Mermaid](https://mermaid-js.github.io/) is a Javascript based diagramming and charting tool. It generates diagrams flowcharts and more, using markdown-inspired text for ease and speed.
+
+It allows to quickly write:
+
+- flow chart,
+- pie chart,
+- sequence diagram,
+- class diagram,
+- state diagram,
+- entity relationship diagram,
+- user journey,
+- gantt
+
+There are two ways to create a diagram in your Jekyll blog page:
+
+````
+```mermaid!
+pie title Pets adopted by volunteers
+  "Dogs" : 386
+  "Cats" : 85
+  "Rats" : 35
+```
+````
+
+or
+
+```markdown
+@startmermaid
+pie title Pets adopted by volunteers
+  "Dogs" : 386
+  "Cats" : 85
+  "Rats" : 35
+@endmermaid
+```
+
+Code above would be parsed as:
+
+![Mermaid Diagram](https://user-images.githubusercontent.com/9413601/85282355-2e317300-b4be-11ea-9c30-8f9d61540d14.png)
+
+### 5. Media Usage
+
+How often did you find yourself googling "**How to embed a video/audio in markdown?**"
+
+While its not possible to embed a video/audio in markdown, the best and easiest
+way is to extract a frame from the video/audio. To add videos/audios to your
+markdown files easier I developped this tool for you, and it will parse the
+video/audio link inside the image block automatically.
+
+**For now, these media links parsing are provided:**

 - Youtube
 - Vimeo
 - DailyMotion
+- Spotify
+- SoundCloud
+- General Video ( mp4 | avi | ogg | ogv | webm | 3gp | flv | mov ... )
+- General Audio ( mp3 | wav | ogg | mid | midi | aac | wma ... )

-There are two ways to embed a video in your Jekyll blog page:
+There are two ways to embed a video/audio in your Jekyll blog page:

 Inline-style:

 ```markdown
-![]({video-link})
+![]({media-link})
 ```

 Reference-style:
@ -461,27 +740,23 @@ Reference-style:
 ```markdown
 ![][{reference}]

-[{reference}]: {video-link}
+[{reference}]: {media-link}
 ```

-For configuring video attributes (e.g, width, height), just adding query string to
+For configuring media attributes (e.g, width, height), just adding query string to
 the link as below:

 ```markdown
 ![](https://www.youtube.com/watch?v=Ptk_1Dc2iPY?width=800&height=500)
-```

-```markdown
-![](https://www.dailymotion.com/video/x7tfyq3?width=100%&height=400)
+![](https://www.dailymotion.com/video/x7tfyq3?width=100%&height=400&autoplay=1)
 ```

 #### Youtube Usage

 ```markdown
 ![](https://www.youtube.com/watch?v=Ptk_1Dc2iPY)
-```

-```markdown
 ![](//www.youtube.com/watch?v=Ptk_1Dc2iPY?width=800&height=500)
 ```

@ -489,9 +764,7 @@ the link as below:

 ```markdown
 ![](https://vimeo.com/263856289)
-```

-```markdown
 ![](https://vimeo.com/263856289?width=500&height=320)
 ```

@ -499,13 +772,47 @@ the link as below:

 ```markdown
 ![](https://www.dailymotion.com/video/x7tfyq3)
-```

-```markdown
 ![](https://dai.ly/x7tgcev?width=100%&height=400)
 ```

-### 5. Hybrid HTML with Markdown
+#### Spotify Usage
+
+```markdown
+![](http://open.spotify.com/track/4Dg5moVCTqxAb7Wr8Dq2T5)
+```
+
+<image width="600" src="https://user-images.githubusercontent.com/9413601/89762618-5d11b000-db23-11ea-81db-35cc3682b234.png">
+
+#### SoundCloud Usage
+
+```markdown
+![](https://soundcloud.com/aviciiofficial/preview-avicii-vs-lenny)
+```
+
+<image width="600" src="https://user-images.githubusercontent.com/9413601/89762969-1c666680-db24-11ea-97e3-4340f7fac7ac.png">
+
+#### General Video Usage
+
+```markdown
+![](//www.html5rocks.com/en/tutorials/video/basics/devstories.webm)
+
+![](//techslides.com/demos/sample-videos/small.ogv?allow=autoplay)
+
+![](//techslides.com/demos/sample-videos/small.mp4?width=400)
+```
+
+#### General Audio Usage
+
+```markdown
+![](//www.soundhelix.com/examples/mp3/SoundHelix-Song-1.mp3)
+
+![](//www.soundhelix.com/examples/mp3/SoundHelix-Song-1.mp3?autoplay=1&loop=1)
+```
+
+<image width="300" src="https://user-images.githubusercontent.com/9413601/89762143-68181080-db22-11ea-8467-e8b2a8a96ae5.png">
+
+### 6. Hybrid HTML with Markdown

 As markdown is not only a lightweight markup language with plain-text-formatting syntax, but also an easy-to-read and easy-to-write plain text format, so writing a hybrid HTML with markdown is an awesome choice.

@ -519,7 +826,7 @@ It's easy to write markdown inside HTML:

 | :        Fruits \|\| Food       : |||
 | :--------- | :-------- | :--------  |
-| Apple      | :  Apple :| Apple      \
+| Apple      | : Apple : | Apple      \
 | Banana     |   Banana  | Banana     \
 | Orange     |   Orange  | Orange     |
 | :   Rowspan is 4    : || How's it?  |
@ -539,7 +846,7 @@ Bob -> Alice : hello
 </script>
 ```

-### 6. Markdown Polyfill
+### 7. Markdown Polyfill

 It allows us to polyfill features for extending markdown syntax.

@ -547,7 +854,7 @@ It allows us to polyfill features for extending markdown syntax.

 - Escape ordered list

-#### Escape Ordered List
+#### 7.1 Escape Ordered List

 A backslash at begin to escape the ordered list.

@ -581,11 +888,136 @@ Escaped:
 10. List item Cafe.
 ```

+### 8. Emoji Usage
+GitHub-flavored emoji images and names would allow emojifying content such as: it's raining :cat:s and :dog:s!
+
+Noted that emoji images are served from the GitHub.com CDN, with a base URL of [https://github.githubassets.com](https://github.githubassets.com), which results in emoji image URLs like [https://github.githubassets.com/images/icons/emoji/unicode/1f604.png](https://github.githubassets.com/images/icons/emoji/unicode/1f604.png).
+
+In any page or post, use emoji as you would normally, e.g.
+
+```
+I give this plugin two :+1:!
+```
+
+**Code above would be parsed as:**
+
+I give this plugin two :+1:!
+
+#### 8.1 Emoji Customizing
+
+If you'd like to serve emoji images locally, or use a custom emoji source, you can specify so in your `_config.yml` file:
+
+```yml
+jekyll-spaceship:
+  emoji-processor:
+    src: "/assets/images/emoji"
+```
+
+See the [Gemoji](https://github.com/github/gemoji) documentation for generating image files.
+
+### 9. Modifying Element Usage
+
+It allows us to modify elements via `CSS3 selectors`. Through it you can easily
+modify the attributes of an element tag, replace the children nodes and so on, 
+it's very flexible, but here is example usage for modifying a document:
+
+```yml
+# Here is a comprehensive example
+jekyll-spaceship:
+  element-processor:
+    css:
+      - a: '<h1>Test</h1>'                     # Replace all `a` tags (String Style)
+      - ['a.link1', 'a.link2']:                # Replace all `a.link1`, `a.link2` tags (Hash Style)
+          name: img                            # Replace element tag name
+          props:                               # Replace element properties
+            title: Good image                  # Add a title attribute
+            src: ['(^.*$)', '\0?a=123']        # Add query string to src attribute by regex pattern
+            style:                             # Add style attribute (Hash Style)
+              color: red
+              font-size: '1.2em'
+          children:                            # Add children to the element
+            -                                  # First empty for adding after the last child node
+            - "<span>Google</span>"            # First child node (String Style)
+            -                                  # Middle empty for wrapping the children nodes
+            - name: span                       # Second child node (Hash Style)
+              props:
+                prop1: "1"                     # Custom property1
+                prop2: "2"                     # Custom property2
+                prop3: "3"                     # Custom property3
+              children:                        # Add nested chidren nodes
+                - "<span>Jekyll</span>"        # First child node (String Style)
+                - name: span                   # Second child node (Hash Style)
+                  props:                       # Add attributes to child node (Hash Style)
+                    prop1: "a"
+                    prop2: "b"
+                    prop3: "c"
+                  children: "<b>Yap!</b>"      # Add children nodes (String Style)
+            -                                  # Last empty for adding before the first child node
+      - a.link: '<a href="//t.com">Link</a>'   # Replace all `a.link` tags (String Style)
+      - 'h1#title':                            # Replace `h1#title` tags (Hash Style)
+          children: I'm a title!               # Replace inner html to new text
+```
+
+#### Example 1
+
+Automatically adds a `target="_blank" rel="noopener noreferrer"` attribute to all external links in Jekyll's content.
+
+```yml
+jekyll-spaceship:
+  element-processor:
+    css:
+      - a:                                     # Replace all `a` tags
+          props:
+            class: ['(^.*$)', '\0 ext-link']   # Add `ext-link` to class by regex pattern
+            target: _blank                     # Replace `target` value to `_blank`
+            rel: noopener noreferrer           # Replace `rel` value to `noopener noreferrer`
+```
+
+#### Example 2
+
+Automatically adds `loading="lazy"` to `img` and `iframe` tags to natively load lazily.
+[Browser support](https://caniuse.com/#feat=loading-lazy-attr) is growing. If a browser does not support the `loading` attribute, it will load the resource just like it would normally.
+
+```yml
+jekyll-spaceship:
+  element-processor:
+    css:
+      - a:                                     # Replace all `a` tags
+          props:                               #
+            loading: lazy                      # Replace `loading` value to `lazy`
+```
+
+In case you want to prevent loading some images/iframes lazily, add
+`loading="eager"` to their tags. This might be useful to prevent flickering of
+images during navigation (e.g. the site's logo).
+
+See the following examples to prevent lazy loading.
+
+```yml
+jekyll-spaceship:
+  element-processor:
+    css:
+      - a:                                     # Replace all `a` tags
+          props:                               #
+            loading: eager                     # Replace `loading` value to `eager`
+```
+
+There are three options when using this method to lazy load images. Here are the supported values for the loading attribute:
+
+- auto: Default lazy-loading behavior of the browser, which is the same as not including the attribute.
+- lazy: Defer loading of the resource until it reaches a calculated distance from the viewport.
+- eager: Load the resource immediately, regardless of where it’s located on the page.
+
+
 ## Credits

 - [Jekyll](https://github.com/jekyll/jekyll) - A blog-aware static site generator in Ruby.
 - [MultiMarkdown](https://fletcher.github.io/MultiMarkdown-6) - Lightweight markup processor to produce HTML, LaTeX, and more.
 - [markdown-it-multimd-table](https://github.com/RedBug312/markdown-it-multimd-table) - Multimarkdown table syntax plugin for markdown-it markdown parser.
+- [jmoji](https://github.com/jekyll/jemoji) - GitHub-flavored emoji plugin for Jekyll.
+- [jekyll-target-blank](https://github.com/keithmifsud/jekyll-target-blank) - Automatically opens external links in a new browser for Jekyll Pages, Posts and Docs.
+- [jekyll-loading-lazy](https://github.com/gildesmarais/jekyll-loading-lazy) - Automatically adds loading="lazy" to img and iframe tags to natively load lazily.
+- [mermaid](https://github.com/mermaid-js/mermaid) - Generation of diagram and flowchart from text in a similar manner as markdown.

 ## Contributing

--- a/jekyll-spaceship.gemspec
+++ b/jekyll-spaceship.gemspec
@ -9,7 +9,7 @@ Gem::Specification.new do |spec|
  spec.version       = Jekyll::Spaceship::VERSION
  spec.authors       = ["jeffreytse"]
  spec.email         = ["jeffreytse.mail@gmail.com"]
-  spec.summary       = "A Jekyll plugin to provide powerful supports for table, mathjax, plantuml, youtube, vimeo, dailymotion, etc."
+  spec.summary       = "A Jekyll plugin to provide powerful supports for table, mathjax, plantuml, mermaid, emoji, video, audio, youtube, vimeo, dailymotion, spotify, soundcloud, etc."
  spec.homepage      = "https://github.com/jeffreytse/jekyll-spaceship"
  spec.license       = "MIT"

@ -20,6 +20,8 @@ Gem::Specification.new do |spec|

  spec.add_dependency "jekyll", ">= 3.6", "< 5.0"
  spec.add_dependency "nokogiri", "~> 1.6"
+  spec.add_dependency "gemoji", "~> 3.0"
+  spec.add_dependency "rainbow", "~> 3.0"

  spec.add_development_dependency "bundler"
  spec.add_development_dependency "rake", "~> 12.0"
--- a/lib/jekyll-spaceship.rb
+++ b/lib/jekyll-spaceship.rb
@ -1,14 +1,12 @@
 # frozen_string_literal: true

 require 'jekyll-spaceship/cores/logger'
+require 'jekyll-spaceship/cores/config'
+require 'jekyll-spaceship/cores/manager'
 require 'jekyll-spaceship/cores/processor'
 require 'jekyll-spaceship/cores/register'

 module Jekyll::Spaceship
  Logger.display_info
-  Register.use 'table-processor'
-  Register.use 'mathjax-processor'
-  Register.use 'plantuml-processor'
-  Register.use 'polyfill-processor'
-  Register.use 'video-processor'
+  Config.load_config
 end
--- a/lib/jekyll-spaceship/cores/config.rb
+++ b/lib/jekyll-spaceship/cores/config.rb
@ -0,0 +1,61 @@
+# frozen_string_literal: true
+
+module Jekyll::Spaceship
+  class Config
+    CONFIG_NAME = 'jekyll-spaceship'
+    DEFAULT_CONFIG = {
+      'processors' => [
+        'table-processor',
+        'mathjax-processor',
+        'plantuml-processor',
+        'mermaid-processor',
+        'polyfill-processor',
+        'media-processor',
+        'emoji-processor',
+        'element-processor'
+      ]
+    }
+
+    @@store = {}
+
+    def self.deep_merge(first, second)
+      merger = proc do |_, f, s|
+        if Hash === f && Hash === s
+          f.merge(s, &merger)
+        elsif Array === f && Array === s
+          s || f
+        else
+          [:undefined, nil, :nil].include?(s) ? f : s
+        end
+      end
+      first.merge(second.to_h, &merger)
+    end
+
+    def self.store(section, default)
+      return @@store[section] if default.nil?
+      @@store[section] = deep_merge(default, @@store[section])
+    end
+
+    def self.load(config = {})
+      config = deep_merge(
+        { CONFIG_NAME => DEFAULT_CONFIG },
+        config
+      )[CONFIG_NAME]
+      @@store = config
+      self.use_processors(config)
+    end
+
+    def self.use_processors(config)
+      config['processors'].each do |processor|
+        Register.use processor
+      end
+    end
+
+    def self.load_config
+      # post load site config for `group :jekyll_plugin`
+      Jekyll::Hooks.register :site, :after_init do |site|
+        self.load(site.config)
+      end
+    end
+  end
+end
--- a/lib/jekyll-spaceship/cores/logger.rb
+++ b/lib/jekyll-spaceship/cores/logger.rb
@ -1,21 +1,36 @@
 # frozen_string_literal: true

 require 'jekyll-spaceship/version'
+require 'rainbow/refinement'
+
+using Rainbow

 module Jekyll::Spaceship
  class Logger
+    def initialize(namespace)
+      @namespace = namespace
+    end
+
    def self.display_info
-      self.log "Jekyll-Spaceship #{Jekyll::Spaceship::VERSION}"
-      self.log 'A Jekyll plugin to provide powerful supports.'
-      self.log 'https://github.com/jeffreytse/jekyll-spaceship'
+      self.log "🚀 Jekyll-Spaceship #{Jekyll::Spaceship::VERSION}"
+      self.log '🎉 A Jekyll plugin to provide powerful supports.'
+      self.log '👉 ' + 'https://github.com/jeffreytse/jekyll-spaceship'.underline
    end

    def self.log(content)
-      self.output 'Jekyll Spaceship', content
+      self.output 'Jekyll Spaceship', content.bright
    end

    def self.output(title, content)
      puts "#{title.rjust(18)}: #{content}"
    end
+
+    def log(content)
+      if @namespace.nil?
+        self.class.log content
+      else
+        self.class.log "[#{@namespace}] #{content}"
+      end
+    end
  end
 end
--- a/lib/jekyll-spaceship/cores/manager.rb
+++ b/lib/jekyll-spaceship/cores/manager.rb
@ -0,0 +1,119 @@
+# frozen_string_literal: true
+
+require 'nokogiri'
+require __dir__ + '/type'
+
+module Jekyll::Spaceship
+  class Manager
+    @@_hooks = {}
+    @@_processors = []
+
+    def self.add(processor)
+      # register for listening event
+      processor.registers.each do |_register|
+        container = _register.first
+        events = _register.last.uniq
+        events = events.select do |event|
+          next true if event.match(/^post/)
+          next events.index(event.to_s.gsub(/^pre/, 'post').to_sym).nil?
+        end
+        events.each do |event|
+          self.hook container, event
+        end
+      end
+      @@_processors.push(processor)
+      @@_processors = @@_processors.sort { |a, b| b.priority <=> a.priority }
+    end
+
+    def self.hook(container, event, &block)
+      return if not is_hooked? container, event
+
+      handler = ->(page) {
+        self.dispatch page, container, event
+        block.call if block
+      }
+
+      if event.to_s.start_with?('after')
+        Jekyll::Hooks.register container, event do |page|
+          handler.call page
+        end
+      elsif event.to_s.start_with?('post')
+        Jekyll::Hooks.register container, event do |page|
+          handler.call page
+        end
+        # auto add pre-event
+        self.hook container, event.to_s.sub('post', 'pre').to_sym
+      elsif event.to_s.start_with?('pre')
+        Jekyll::Hooks.register container, event do |page|
+          handler.call page
+        end
+      end
+    end
+
+    def self.is_hooked?(container, event)
+      hook_name = "#{container}_#{event}".to_sym
+      return false if @@_hooks.has_key? hook_name
+      @@_hooks[hook_name] = true
+    end
+
+    def self.dispatch(page, container, event)
+      @@_processors.each do |processor|
+        processor.dispatch page, container, event
+      end
+      if event.to_s.start_with?('post') and Type.html? output_ext(page)
+        self.dispatch_html_block(page)
+      end
+      @@_processors.each do |processor|
+        processor.on_handled if processor.handled
+      end
+    end
+
+    def self.ext(page)
+      ext = page.path.match(/\.[^.]+$/)
+      ext.to_s.rstrip
+    end
+
+    def self.output_ext(page)
+      page.url_placeholders[:output_ext]
+    end
+
+    def self.converter(page, name)
+      page.site.converters.each do |converter|
+        class_name = converter.class.to_s.downcase
+        return converter if class_name.end_with?(name.downcase)
+      end
+    end
+
+    def self.dispatch_html_block(page)
+      doc = Nokogiri::HTML(page.output)
+      doc.css('script').each do |node|
+        type = Type.html_block_type node['type']
+        content = node.content
+        next if type.nil?
+
+        # dispatch to on_handle_html_block
+        @@_processors.each do |processor|
+          next unless processor.process?
+          content = processor.on_handle_html_block content, type
+          # dispatch to type handlers
+          method = "on_handle_#{type}"
+          next unless processor.respond_to? method
+          content = processor.pre_exclude content
+          content = processor.send method, content
+          content = processor.after_exclude content
+        end
+
+        cvter = self.converter page, type
+        content = cvter.convert content unless cvter.nil?
+
+        # dispatch to on_handle_html
+        @@_processors.each do |processor|
+          next unless processor.process?
+          content = processor.on_handle_html content
+        end
+        node.replace Nokogiri::HTML.fragment content
+      end
+      page.output = Processor.escape_html doc.to_html
+    end
+  end
+end
--- a/lib/jekyll-spaceship/cores/processor.rb
+++ b/lib/jekyll-spaceship/cores/processor.rb
@ -1,325 +1,236 @@
 # frozen_string_literal: true

-require 'nokogiri'
-
 module Jekyll::Spaceship
  class Processor
-    @@_hooks = {}
-    @@_registers = []
-    @@_processers = []
-    @@_exclusions = []
-    @@_priority = nil
-
-    attr_accessor :priority
-    attr_accessor :page
-    attr_accessor :handled
-
    DEFAULT_PRIORITY = 20

    PRIORITY_MAP = {
-      :low    => 10,
-      :normal => 20,
-      :high   => 30,
+      :lowest  => 0,
+      :low     => 10,
+      :normal  => 20,
+      :high    => 30,
+      :highest => 40,
    }.freeze

-    HTML_EXTENSIONS = %w(
-      .html
-      .xhtml
-      .htm
-    ).freeze
+    @@_registers = []
+    @@_exclusions = []
+    @@_priority = nil

-    CSS_EXTENSIONS = %w(
-      .css
-      .scss
-    ).freeze
+    attr_reader :page
+    attr_reader :logger
+    attr_reader :config
+    attr_reader :priority
+    attr_reader :registers
+    attr_reader :exclusions
+    attr_accessor :handled

-    MD_EXTENSIONS = %w(
-      .md
-      .markdown
-    ).freeze
+    def name
+      self.class.name.split('::').last
+    end
+
+    def filename
+      self.name
+        .gsub(/([A-Z]+)([A-Z][a-z])/,'\1-\2')
+        .gsub(/([a-z\d])([A-Z])/,'\1-\2')
+        .tr("_", "-")
+        .downcase
+    end

    def initialize()
      self.initialize_priority
      self.initialize_register
      self.initialize_exclusions
+      @logger = Logger.new(self.name)
+      @config = Config.store(self.filename, self.class.config)
+      @handled_files = {}
    end

    def initialize_priority
-      @@_priority = DEFAULT_PRIORITY if @@_priority.nil?
      @priority = @@_priority
+      unless @priority.nil? or @priority.is_a? Numeric
+        @priority = PRIORITY_MAP[@priority.to_sym]
+      end
+      @priority = DEFAULT_PRIORITY if @priority.nil?
      @@_priority = nil
-
-      @@_processers.push(self)
-      @@_processers = @@_processers.sort { |a, b| b.priority <=> a.priority }
    end

    def initialize_register
      if @@_registers.size.zero?
        self.class.register :pages, :pre_render, :post_render
-        self.class.register :posts, :pre_render, :post_render
-      end
-
-      @@_registers.each do |_register|
-        container = _register.first
-        events = _register.last.uniq
-        events = events.select do |event|
-          next true if event.match(/^post/)
-          next !events.any?(event.to_s.gsub(/^pre/, 'post').to_sym)
-        end
-        events.each do |event|
-          self.class.hook container, event
-        end
+        self.class.register :documents, :pre_render, :post_render
      end
+      @registers = Array.new @@_registers
      @@_registers.clear
    end

    def initialize_exclusions
      if @@_exclusions.size.zero?
-        self.class.exclude :code, :block_quotes
+        self.class.exclude :code, :math, :liquid_filter
      end
-      @_exclusions = @@_exclusions.uniq
+      @exclusions = @@_exclusions.uniq
      @@_exclusions.clear
    end

    def self.priority(value)
-      value = value.to_sym
-      if PRIORITY_MAP.has_key? value
-        @@_priority = PRIORITY_MAP[value]
-      elsif value.nil?
-        @@_priority = DEFAULT_PRIORITY
-      else
-        @@_priority = value
-      end
+      @@_priority = value.to_sym
    end

    def self.register(container, *events)
      @@_registers << [container, events]
    end

-    def self.hook_register(container, event)
-      hook_name = "#{container}_#{event}".to_sym
-      return false if @@_hooks.has_key? hook_name
-      @@_hooks[hook_name] = true
-    end
-
-    def self.hook(container, event, &block)
-      return if not hook_register container, event
-
-      # define dispatch proc
-      dispatch = ->(instance) {
-        @@_processers.each do |processor|
-          processor.page = instance
-          processor.handled = false
-          next if not processor.process?
-          processor.dispatch container, event
-        end
-        if event.to_s.start_with?('post') and self.html? output_ext(instance)
-          self.handle_html_block(instance)
-        end
-        @@_processers.each do |processor|
-          processor.page = instance
-          if processor.handled
-            processor.on_handled
-          end
-        end
-        block.call if block
-      }
-
-      if event.to_s.start_with?('after')
-        Jekyll::Hooks.register container, event do |instance|
-          dispatch.call instance
-        end
-      elsif event.to_s.start_with?('post')
-        Jekyll::Hooks.register container, event do |instance|
-          dispatch.call instance
-        end
-
-        # auto add pre-event
-        register container, event.to_s.sub('post', 'pre').to_sym
-      elsif event.to_s.start_with?('pre')
-        Jekyll::Hooks.register container, event do |instance|
-          dispatch.call instance
-        end
-      end
-    end
-
-    def dispatch(container, event)
-      method = "on_#{container}_#{event}"
-      self.send method, @page if self.respond_to? method
-
-      if event.to_s.start_with?('pre')
-        if markdown? ext
-          method = 'on_handle_markdown'
-        else
-          method = ''
-        end
-
-        if self.respond_to? method
-          @page.content = self.pre_exclude @page.content
-          @page.content = self.send method, @page.content
-          @page.content = self.after_exclude @page.content
-        end
-      else
-        if html? output_ext
-          method = 'on_handle_html'
-        elsif css? output_ext
-          method = 'on_handle_css'
-        else
-          method = ''
-        end
-
-        if self.respond_to? method
-          @page.output = self.send method, @page.output
-        end
-      end
-    end
-
    def self.exclude(*types)
      @@_exclusions = types
    end

-    def html?(_ext)
-      self.class.html? _ext
-    end
-
-    def css?(_ext)
-      self.class.css? _ext
-    end
-
-    def markdown?(_ext)
-      self.class.markdown? _ext
-    end
-
-    def self.html?(_ext)
-      HTML_EXTENSIONS.include?(_ext)
-    end
-
-    def self.css?(_ext)
-      CSS_EXTENSIONS.include?(_ext)
-    end
-
-    def self.markdown?(_ext)
-      MD_EXTENSIONS.include?(_ext)
-    end
-
-    def converter(name)
-      self.class.converter(@page, name)
-    end
-
-    def self.converter(instance, name)
-      instance.site.converters.each do |converter|
-        class_name = converter.class.to_s.downcase
-        return converter if class_name.end_with?(name.downcase)
-      end
-    end
-
-    def ext
-      self.class.ext @page
-    end
-
-    def output_ext
-      self.class.output_ext @page
-    end
-
-    def self.ext(instance)
-      instance.data['ext']
-    end
-
-    def self.output_ext(instance)
-      instance.url_placeholders[:output_ext]
+    def self.config
    end

    def process?
-      html?(output_ext) or markdown?(ext)
+      Type.html?(output_ext) or Type.markdown?(ext)
    end

-    def pre_exclude(content)
-      @_exclusion_store = []
-      @_exclusions.each do |type|
-        regex = nil
-        if type == :code
-          regex = /(`{3}\s*(\w*)((?:.|\n)*?)`{3})/
+    def ext
+      Manager.ext @page
+    end
+
+    def output_ext
+      Manager.output_ext @page
+    end
+
+    def converter(name)
+      Manager.converter @page, name
+    end
+
+    def dispatch(page, container, event)
+      @page = page
+      @handled = false
+      return unless self.process?
+      method = "on_#{container}_#{event}"
+      self.send method, @page if self.respond_to? method
+      method = ''
+      if event.to_s.start_with?('pre')
+        if Type.markdown? ext
+          method = 'on_handle_markdown'
        end
-        next if regex.nil?
-        content.scan(regex) do |match_data|
-          match = match_data[0]
-          id = @_exclusion_store.size
-          content = content.gsub(match, "[//]: JEKYLL_EXCLUDE_##{id}")
-          @_exclusion_store.push match
+        if self.respond_to? method
+          @page.content = self.pre_exclude @page.content
+          @page.content = self.send method, @page.content
+          @page.content = self.post_exclude @page.content
+        end
+      else
+        if Type.html? output_ext
+          method = 'on_handle_html'
+        elsif Type.css? output_ext
+          method = 'on_handle_css'
+        end
+        if self.respond_to? method
+          @page.output = self.send method, @page.output
+          if Type.html? output_ext
+            @page.output = self.class.escape_html(@page.output)
+          end
        end
      end
+    end
+
+    def on_handle_html_block(content, type)
+      # default handle method
      content
    end

-    def after_exclude(content)
-      while @_exclusion_store.size > 0
-        match = @_exclusion_store.pop
-        id = @_exclusion_store.size
-        content = content.gsub("[//]: JEKYLL_EXCLUDE_##{id}", match)
-      end
-      @_exclusion_store = []
+    def on_handle_html(content)
+      # default handle method
      content
    end

    def on_handled
-      processor = self.class.name.split('::').last
-      file = page.path.gsub(/.*_posts\//, '')
-      Logger.log "[#{processor}] #{file}"
+      source = page.site.source
+      file = page.path.sub(/^#{source}\//, '')
+      return if @handled_files.has_key? file
+      @handled_files[file] = true
+      logger.log file
    end

-    def self.handle_html_block(instance)
-      doc = Nokogiri::HTML(instance.output)
-
-      doc.css('script').each do |node|
-        blk_type = node['type']
-        blk_content = node.content
-
-        cvter = nil
-        method = ''
-        block_method = 'on_handle_html_block'
-
-        case blk_type
-        when 'text/markdown'
-          method = 'on_handle_markdown'
-          cvter = self.converter(instance, 'markdown')
+    def exclusion_regexs()
+      regexs = []
+      @exclusions.each do |type|
+        regex = nil
+        if type == :code
+          regex = /(((?<!\\)`+)\s*(\w*)((?:.|\n)*?)\2)/
+        elsif type == :math
+          regex = /(((?<!\\)\${1,2})[^\n]*?\1)/
+        elsif type == :liquid_filter
+          regex = /((?<!\\)((\{\{[^\n]*?\}\})|(\{%[^\n]*?%\})))/
        end
-
-        @@_processers.each do |processor|
-          processor.page = instance
-          next if not processor.process?
-
-          # dispatch to on_handle_html_block
-          if processor.respond_to? block_method
-            blk_content = processor.send block_method blk_content, blk_type
-          end
-
-          # dispatch to other handlers
-          if processor.respond_to? method
-            blk_content = processor.pre_exclude blk_content
-            blk_content = processor.send method, blk_content
-            blk_content = processor.after_exclude blk_content
-          end
-        end
-
-        if not cvter.nil?
-          blk_content = cvter.convert blk_content
-        end
-
-        next if method == ''
-
-        method = 'on_handle_html'
-        @@_processers.each do |processor|
-          processor.page = instance
-          next if not processor.process?
-          if processor.respond_to? method
-            blk_content = processor.send method, blk_content
-          end
-        end
-
-        node.replace Nokogiri::HTML.fragment(blk_content)
+        regexs.push regex unless regex.nil?
      end
+      regexs
+    end

-      instance.output = doc.to_html
+    def pre_exclude(content, regexs = self.exclusion_regexs())
+      @exclusion_store = []
+      regexs.each do |regex|
+        content.scan(regex) do |match_data|
+          match = match_data[0]
+          id = @exclusion_store.size
+          content = content.sub(match, "<!JEKYLL@#{object_id}@#{id}>")
+          @exclusion_store.push match
+        end
+      end
+      content
+    end
+
+    def post_exclude(content)
+      while @exclusion_store.size > 0
+        match = @exclusion_store.pop
+        id = @exclusion_store.size
+        content = content.sub("<!JEKYLL@#{object_id}@#{id}>", match)
+      end
+      @exclusion_store = []
+      content
+    end
+
+    def self.escape_html(content)
+      # escape link
+      content.scan(/((https?:)?\/\/\S+\?[a-zA-Z0-9%\-_=\.&;]+)/) do |result|
+        result = result[0]
+        link = result.gsub('&amp;', '&')
+        content = content.gsub(result, link)
+      end
+      content
+    end
+
+    def self.fetch_img_data(url)
+      begin
+        res = Net::HTTP.get_response URI(url)
+        raise res.body unless res.is_a?(Net::HTTPSuccess)
+        content_type = res.header['Content-Type']
+        raise 'Unknown content type!' if content_type.nil?
+        content_body = res.body.force_encoding('UTF-8')
+        return {
+          'type' => content_type,
+          'body' => content_body
+        }
+      rescue StandardError => msg
+        logger.log msg
+      end
+    end
+
+    def self.make_img_tag(data)
+      css_class = data['class']
+      type = data['type']
+      body = data['body']
+      if type == 'url'
+        "<img class=\"#{css_class}\" src=\"#{body}\">"
+      elsif type.include?('svg')
+        body.gsub(/\<\?xml.*?\?>/, '')
+          .gsub(/<!--[^\0]*?-->/, '')
+          .sub(/<svg /, "<svg class=\"#{css_class}\" ")
+      else
+        body = Base64.encode64(body)
+        body = "data:#{type};base64, #{body}"
+        "<img class=\"#{css_class}\" src=\"#{body}\">"
+      end
    end
  end
 end
--- a/lib/jekyll-spaceship/cores/register.rb
+++ b/lib/jekyll-spaceship/cores/register.rb
@ -24,21 +24,17 @@ module Jekyll::Spaceship
        filename = File.basename(path, '.rb')
        next if filename.gsub(/-/, '').downcase != name

-        Logger.log "use #{filename}"
-
+        Logger.log "🗂  use #{filename}"
        require path
-
        constants = Jekyll::Spaceship.constants.select do |c|
          c.downcase.to_s == name
        end

        next if constants.first.nil?
-
        _class = Jekyll::Spaceship.const_get(constants.first)
-
        next unless _class.is_a? Class

-        _class.new
+        Manager.add _class.new
      end
    end
  end
--- a/lib/jekyll-spaceship/cores/type.rb
+++ b/lib/jekyll-spaceship/cores/type.rb
@ -0,0 +1,41 @@
+# frozen_string_literal: true
+
+module Jekyll::Spaceship
+  class Type
+    HTML_EXTENSIONS = %w(
+      .html
+      .xhtml
+      .htm
+    ).freeze
+
+    CSS_EXTENSIONS = %w(
+      .css
+      .scss
+    ).freeze
+
+    MD_EXTENSIONS = %w(
+      .md
+      .markdown
+    ).freeze
+
+    HTML_BLOCK_TYPE_MAP = {
+      'text/markdown'  => 'markdown',
+    }.freeze
+
+    def self.html?(_ext)
+      HTML_EXTENSIONS.include?(_ext)
+    end
+
+    def self.css?(_ext)
+      CSS_EXTENSIONS.include?(_ext)
+    end
+
+    def self.markdown?(_ext)
+      MD_EXTENSIONS.include?(_ext)
+    end
+
+    def self.html_block_type(type)
+      HTML_BLOCK_TYPE_MAP[type]
+    end
+  end
+end
--- a/lib/jekyll-spaceship/processors/element-processor.rb
+++ b/lib/jekyll-spaceship/processors/element-processor.rb
@ -0,0 +1,170 @@
+# frozen_string_literal: true
+
+require 'nokogiri'
+
+module Jekyll::Spaceship
+  class ElementProcessor < Processor
+    priority :lowest
+
+    def self.config
+      { 'css' => [] }
+    end
+
+    def on_handle_html(content)
+      return content if config['css'].size.zero?
+
+      # use nokogiri to parse html content
+      doc = Nokogiri::HTML(content)
+
+      # handle each css pattern
+      config['css'].each do |data|
+        data.each do |key, val|
+          key = [key] if key.kind_of? String
+          key.each do |pattern|
+            nodes = doc.css(pattern)
+            nodes.each do |element|
+              handle_css_pattern({
+                :doc => doc,
+                :element => element,
+                :data => val
+              })
+            end
+            self.handled = true
+          end
+        end
+      end
+
+      doc.to_html
+    end
+
+    def handle_css_pattern(data)
+      doc = data[:doc]
+      element = data[:element]
+      data = data[:data]
+
+      if data.kind_of? String
+        element.replace Nokogiri::HTML.fragment(data)
+      elsif data.kind_of? Hash
+        handle_hash_element({
+          :doc => doc,
+          :element => element,
+          :data => data,
+        })
+      end
+    end
+
+    def create_children(data)
+      doc = data[:doc]
+      data = data[:data]
+      root = Nokogiri::HTML.fragment("")
+
+      data = [data] unless data.kind_of? Array
+      data.each do |child_data|
+        node = self.create_element({
+          :doc => doc,
+          :data => child_data
+        })
+        next if node.nil?
+        unless child_data['children'].nil?
+          node.children = self.create_children({
+            :doc => doc,
+            :data => child_data['children']
+          })
+        end
+        root.add_child node
+      end
+      root.children
+    end
+
+    def handle_hash_element(data)
+      doc = data[:doc]
+      element = data[:element]
+      data = data[:data]
+
+      # set name
+      element.name = data['name'] unless data['name'].nil?
+
+      # set props
+      data['props']&.each do |prop, val|
+        next element.remove_attribute if val.nil?
+        if val.kind_of? Array
+          next if val.size != 2
+          v = element[prop]
+          v = '' if v.nil?
+          val = v.sub(/#{val[0]}/, val[1])
+        elsif val.kind_of? Hash
+          result = []
+          val.each { |k, v| result.push "#{k}: #{v}" }
+          val = result.join(";")
+        end
+        element.set_attribute(prop, val)
+      end
+
+      # processing children
+      return unless data.has_key?('children')
+      return element.inner_html = "" if data['children'].nil?
+      children = self.create_children({
+        :doc => doc,
+        :data => data['children']
+      })
+
+      handle_element_placement({
+        :data => data,
+        :element => element,
+        :children => children,
+      })
+    end
+
+    def create_element(data)
+      doc = data[:doc]
+      data = data[:data]
+
+      return if data.nil?
+      return Nokogiri::HTML.fragment(data) if data.kind_of? String
+      return if data['name'].nil?
+
+      # create node
+      node = doc.create_element(data['name'])
+
+      # set props
+      data['props']&.each do |prop, val|
+        if val.kind_of? Hash
+          result = []
+          val.each { |k, v| result.push "#{k}: #{v}" }
+          val = result.join(";")
+        end
+        node.set_attribute(prop, val)
+      end
+      node
+    end
+
+    def handle_element_placement(data)
+      element = data[:element]
+      children = data[:children]
+      data = data[:data]
+
+      # replace whole inner html
+      unless data['children'].kind_of? Array
+        return element.inner_html = children
+      end
+
+      if element.children.size.zero?
+        return element.inner_html = children
+      end
+
+      index = data['children'].index(nil)
+      rindex = data['children'].rindex { |item| !item.nil? }
+
+      if index.nil?
+        element.inner_html = children
+      elsif index == 0 # insert to the end of children
+        element.children.last.after(children)
+      elsif index == rindex + 1 # insert to the begin of children
+          element.children.first.before children
+      else # wrap the children
+        element.children.first.before children[0..index]
+        element.children.last.after children[index..children.size]
+      end
+    end
+  end
+end
--- a/lib/jekyll-spaceship/processors/emoji-processor.rb
+++ b/lib/jekyll-spaceship/processors/emoji-processor.rb
@ -0,0 +1,46 @@
+# frozen_string_literal: true
+
+require 'net/http'
+require 'json'
+require 'gemoji'
+
+module Jekyll::Spaceship
+  class EmojiProcessor < Processor
+    def self.config
+      {
+        'css' => {
+          'class' => 'emoji'
+        },
+        'src' => 'https://github.githubassets.com/images/icons/emoji/'
+      }
+    end
+
+    def on_handle_html(content)
+      # handle emoji markup
+      content.scan(/:([\w\d+-]+):/) do |match|
+        emoji = Emoji.find_by_alias match[0]
+        next if emoji.nil?
+        self.handled = true
+
+        # escape plus sign
+        emoji_name = emoji.name.gsub('+', '\\\+')
+        css_class = self.config['css']['class']
+
+        content = content.gsub(
+          /(?<!\=")\s*:#{emoji_name}:\s*(?!"\s)/,
+          "<img class=\"#{css_class}\""\
+            " title=\":#{emoji.name}:\""\
+            " alt=\":#{emoji.name}:\""\
+            " raw=\"#{emoji.raw}\""\
+            " src=\"#{config['src']}#{emoji.image_filename}\""\
+            " style=\"vertical-align: middle; display: inline;"\
+            " max-width: 1em; visibility: hidden;\""\
+            " onload=\"this.style.visibility='visible'\""\
+            " onerror=\"this.replaceWith(this.getAttribute('raw'))\">"\
+          "</img>"
+        )
+      end
+      content
+    end
+  end
+end
--- a/lib/jekyll-spaceship/processors/mathjax-processor.rb
+++ b/lib/jekyll-spaceship/processors/mathjax-processor.rb
@ -4,8 +4,21 @@ require "nokogiri"

 module Jekyll::Spaceship
  class MathjaxProcessor < Processor
+    def self.config
+      {
+        'src' => [
+          'https://polyfill.io/v3/polyfill.min.js?features=es6',
+          'https://cdn.jsdelivr.net/npm/mathjax@3/es5/tex-mml-chtml.js',
+        ],
+        'config' => {
+          'tex' => { 'inlineMath' => [['$','$'], ['\\(','\\)']] },
+          'svg': { 'fontCache': 'global' }
+        }
+      }
+    end
+
    def process?
-      return true if html?(output_ext)
+      return true if Type.html?(output_ext)
    end

    def on_handle_html(content)
@ -18,17 +31,25 @@ module Jekyll::Spaceship

      self.handled = true

-      params = "config=TeX-AMS-MML_HTMLorMML"
-      src = "//cdn.mathjax.org/mathjax/latest/MathJax.js?#{params}"
-      config = "MathJax.Hub.Config({tex2jax: {inlineMath: [['$','$'], ['\\(','\\)']]}});"
-      head.add_child("<script src=\"#{src}\">#{config}</script>")
+      # add mathjax config
+      cfg = config['config'].to_json
+      head.add_child("<script>MathJax=#{cfg}</script>")
+
+      # add mathjax dependencies
+      config['src'] = [config['src']] if config['src'].is_a? String
+      config['src'].each do |src|
+        head.add_child("<script src=\"#{src}\"></script>")
+      end

      doc.to_html
    end

    def has_mathjax_expression?(doc)
      doc.css('*').each do |node|
-        if node.content.match(/\$.+\$/)
+        if node.content.match(/(?<!\\)\$.+(?<!\\)\$/)
+          return true
+        end
+        if node.content.match(/(?<!\\)\\\(.+(?<!\\)\\\)/)
          return true
        end
      end
--- a/lib/jekyll-spaceship/processors/media-processor.rb
+++ b/lib/jekyll-spaceship/processors/media-processor.rb
@ -0,0 +1,234 @@
+# frozen_string_literal: true
+
+require 'uri'
+
+module Jekyll::Spaceship
+  class MediaProcessor < Processor
+    def self.config
+      {
+        'default' => {
+          'id' => 'media-{id}',
+          'class' => 'media',
+          'width' => '100%',
+          'height' => 350,
+          'frameborder' => 0,
+          'style' => 'max-width: 600px;outline: none',
+          'allow' => 'encrypted-media; picture-in-picture'
+        }
+      }
+    end
+
+    def on_handle_markdown(content)
+      content = handle_normal_audio(content)
+      content = handle_normal_video(content)
+      content = handle_youtube(content)
+      content = handle_vimeo(content)
+      content = handle_dailymotion(content)
+      content = handle_spotify(content)
+      content = handle_soundcloud(content)
+    end
+
+    # Examples:
+    # ![audio](//www.soundhelix.com/examples/mp3/SoundHelix-Song-1.mp3)
+    # ![audio](//www.expample.com/examples/t-rex-roar.mp3?autoplay=true&loop=true)
+    def handle_normal_audio(content)
+      handle_media(content, {
+        media_type: 'audio',
+        host: '(https?:)?\\/\\/.*\\/',
+        id: '(.+?\\.(mp3|wav|ogg|mid|midi|aac|wma))',
+      })
+    end
+
+
+    # Examples:
+    # ![video](//www.html5rocks.com/en/tutorials/video/basics/devstories.webm)
+    # ![video](//techslides.com/demos/sample-videos/small.ogv?allow=autoplay)
+    # ![video](//techslides.com/demos/sample-videos/small.mp4?width=400)
+    def handle_normal_video(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        host: '(https?:)?\\/\\/.*\\/',
+        id: '(.+?\\.(avi|mp4|webm|ogg|ogv|flv|mkv|mov|wmv|3gp|rmvb|asf))'
+      })
+    end
+
+    # Examples:
+    # ![youtube](https://www.youtube.com/watch?v=XA2WjJbmmoM "title")
+    # ![youtube](http://www.youtube.com/embed/w-m_yZCLF5Q)
+    # ![youtube](//youtu.be/mEP3YXaSww8?height=100%&width=400)
+    def handle_youtube(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        host: '(https?:)?\\/\\/.*youtu.*',
+        id: '(?<=\\?v\\=|embed\\/|\\.be\\/)([a-zA-Z0-9\\_\\-]+)',
+        base_url: "https://www.youtube.com/embed/"
+      })
+    end
+
+    # Examples:
+    # ![vimeo](https://vimeo.com/263856289)
+    # ![vimeo](https://vimeo.com/263856289?height=100%&width=400)
+    def handle_vimeo(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        host: '(https?:)?\\/\\/vimeo\\.com\\/',
+        id: '([0-9]+)',
+        base_url: "https://player.vimeo.com/video/"
+      })
+    end
+
+    # Examples:
+    # ![dailymotion](https://www.dailymotion.com/video/x7tgcev)
+    # ![dailymotion](https://dai.ly/x7tgcev?height=100%&width=400)
+    def handle_dailymotion(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        host: '(https?:)?\\/\\/.*dai.?ly.*',
+        id: '(?<=video\\/|\\/)([a-zA-Z0-9\\_\\-]+)',
+        base_url: "https://www.dailymotion.com/embed/video/"
+      })
+    end
+
+    # Examples:
+    # ![spotify](//open.spotify.com/track/4Dg5moVCTqxAb7Wr8Dq2T5)
+    # ![spotify](//open.spotify.com/track/37mEkAaqCE7FXMvnlVA8pp?width=400)
+    def handle_spotify(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        host: '(https?:)?\\/\\/open\\.spotify\\.com\\/track\\/',
+        id: '(?<=track\\/)([a-zA-Z0-9\\_\\-]+)',
+        base_url: "https://open.spotify.com/embed/track/",
+        height: 80
+      })
+    end
+
+    # Examples:
+    # ![soundcloud](//soundcloud.com/aviciiofficial/preview-avicii-vs-lenny)
+    def handle_soundcloud(content)
+      handle_media(content, {
+        media_type: 'iframe',
+        id_from: 'html',
+        host: '(https?:)?\\/\\/soundcloud\\.com\\/.+\\/[^\\?]+',
+        id: '(?<=soundcloud:\\/\\/sounds:)([0-9]+)',
+        base_url: "https://w.soundcloud.com/player/?url="\
+          "https%3A//api.soundcloud.com/tracks/",
+        height: 125,
+      })
+    end
+
+    def handle_media(content, data)
+      host = data[:host]
+      return content if content.sub(/#{host}/, '').nil?
+
+      media_type = data[:media_type]
+      base_url = data[:base_url]
+      id = data[:id_from] === 'html' ? '()' : data[:id]
+      url = "(#{host}#{id}\\S*)"
+      title = '("(.*)".*){0,1}'
+
+      # pre-handle reference-style links
+      regex = /(\[(.*)\]:\s*(#{url}\s*#{title}))/
+      content.scan regex do |match_data|
+        match = match_data[0]
+        ref_name = match_data[1]
+        ref_value = match_data[2]
+        content = content.gsub(match, '')
+          .gsub(/\!\[(.*)\]\s*\[#{ref_name}\]/,
+            "![\1](#{ref_value})")
+      end
+
+      # handle inline-style links
+      regex = /(\!\[(.*)\]\(.*#{url}\s*#{title}\))/
+      content.scan regex do |match_data|
+        url = match_data[2]
+        id = data[:id_from] === 'html' \
+          ? get_id_from_html(url, data[:id]) \
+          : match_data[4]
+        title = match_data[6]
+        qs = url.match(/(?<=\?)(\S*?)$/)
+        qs = Hash[URI.decode_www_form(qs.to_s)].reject do |k, v|
+          next true if v == id or v == ''
+        end
+
+        cfg = self.config['default'].clone
+        cfg['id'] = qs['id'] || cfg['id']
+        cfg['class'] = qs['class'] || cfg['class']
+        cfg['style'] = qs['style'] || cfg['style']
+        cfg['id'] = cfg['id'].gsub('{id}', id)
+        cfg['class'] = cfg['class'].gsub('{id}', id)
+
+        cfg['src'] = URI(base_url ? "#{base_url}#{id}" : url).tap do |v|
+          v.query = URI.encode_www_form(qs) if qs.size > 0
+        end
+
+        case media_type
+        when 'audio'
+          cfg['autoplay'] = qs['autoplay'] || data[:autoplay] || cfg['autoplay']
+          cfg['loop'] = qs['loop'] || data[:loop] || cfg['loop']
+          cfg['style'] += ';display: none;' if qs['hidden']
+          content = handle_audio(content, { target: match_data[0], cfg: cfg })
+        when 'iframe'
+          cfg['title'] = title
+          cfg['width'] = qs['width'] || data[:width] || cfg['width']
+          cfg['height'] = qs['height'] || data[:height] || cfg['height']
+          cfg['frameborder'] = qs['frameborder'] || cfg['frameborder']
+          cfg['allow'] ||= cfg['allow']
+          content = handle_iframe(content, { target: match_data[0], cfg: cfg })
+        end
+        self.handled = true
+      end
+      content
+    end
+
+    def handle_audio(content, data)
+      cfg = data[:cfg]
+      html = "<audio"\
+        " id=\"#{cfg['id']}\""\
+        " class=\"#{cfg['class']}\""\
+        " #{cfg['autoplay'] ? 'autoplay' : ''}"\
+        " #{cfg['loop'] ? 'loop' : ''}"\
+        " src=\"#{cfg['src']}\""\
+        " style=\"#{cfg['style']}\""\
+        " controls>" \
+        "<p> Your browser doesn't support HTML5 audio."\
+        " Here is a <a href=\"#{cfg['src']}\">link to download the audio</a>"\
+        "instead. </p>"\
+        "</audio>"
+      content.gsub(data[:target], html)
+    end
+
+    def handle_iframe(content, data)
+      cfg = data[:cfg]
+      html = "<iframe"\
+        " id=\"#{cfg['id']}\""\
+        " class=\"#{cfg['class']}\""\
+        " src=\"#{cfg['src']}\""\
+        " title=\"#{cfg['title']}\""\
+        " width=\"#{cfg['width']}\""\
+        " height=\"#{cfg['height']}\""\
+        " style=\"#{cfg['style']}\""\
+        " allow=\"#{cfg['allow']}\""\
+        " frameborder=\"#{cfg['frameborder']}\""\
+        " allowfullscreen>"\
+        "</iframe>"
+      content.gsub(data[:target], html)
+    end
+
+    def get_id_from_html(url, pattern)
+      id = ''
+      begin
+        url = 'https:' + url if url.start_with? '//'
+        res = Net::HTTP.get_response URI(url)
+        raise res.body unless res.is_a?(Net::HTTPSuccess)
+        res.body.match pattern do |match_data|
+          id = match_data[0]
+          break
+        end
+      rescue StandardError => msg
+        data = url
+        logger.log msg
+      end
+      id
+    end
+  end
+end
--- a/lib/jekyll-spaceship/processors/mermaid-processor.rb
+++ b/lib/jekyll-spaceship/processors/mermaid-processor.rb
@ -0,0 +1,102 @@
+# frozen_string_literal: true
+
+require "net/http"
+require "base64"
+
+module Jekyll::Spaceship
+  class MermaidProcessor < Processor
+    exclude :none
+
+    def self.config
+      {
+        'mode' => 'default',
+        'syntax' => {
+          'code' => 'mermaid!',
+          'custom' => ['@startmermaid', '@endmermaid']
+        },
+        'css' => {
+          'class' => 'mermaid'
+        },
+        'config': {
+          'theme' => 'default'
+        },
+        'src' => 'https://mermaid.ink/svg/'
+      }
+    end
+
+    def on_handle_markdown(content)
+      # match custom mermaid block and code block
+      syntax = self.config['syntax']
+      code_name = syntax['code']
+      custom = syntax['custom'][-2, 2]
+
+      patterns = [
+        /((`{3,})\s*#{code_name}((?:.|\n)*?)\2)/,
+        /((?<!\\)(#{custom[0]})((?:.|\n)*?)(?<!\\)(#{custom[1]}))/
+      ]
+
+      patterns.each do |pattern|
+        content = handle_mermaid_block(pattern, content)
+      end
+
+      # handle escape custom mermaid block
+      content.gsub(/\\(#{custom[0]}|#{custom[1]})/, '\1')
+    end
+
+    def handle_mermaid_block(pattern, content)
+      content.scan pattern do |match|
+        match = match.select { |m| not m.nil? }
+        block = match[0]
+        code = match[2]
+
+        self.handled = true
+
+        content = content.gsub(
+          block,
+          handle_mermaid(code)
+        )
+      end
+      content
+    end
+
+    def handle_mermaid(code)
+      # encode to UTF-8
+      code = code.encode('UTF-8')
+      url = get_url(code)
+
+      # render mode
+      case self.config['mode']
+      when 'pre-fetch'
+        data = self.class.fetch_img_data(url)
+      end
+      if data.nil?
+        data = { 'type' => 'url', 'body' => url }
+      end
+
+      # return img tag
+      data['class'] = self.config['css']['class']
+      self.class.make_img_tag(data)
+    end
+
+    def get_url(code)
+      src = self.config['src']
+
+      # wrap code
+      code = {
+        'code' => code.gsub(/^\s*|\s*$/, ''),
+        'mermaid' => config['config']
+      }.to_json
+
+      # set default method
+      src += '{code}' if src.match(/\{.*\}/).nil?
+
+      # encode to base64 string
+      if src.include?('{code}')
+        code = Base64.urlsafe_encode64(code, padding: false)
+        return src.gsub('{code}', code)
+      else
+        raise "No supported src ! #{src}"
+      end
+    end
+  end
+end
--- a/lib/jekyll-spaceship/processors/plantuml-processor.rb
+++ b/lib/jekyll-spaceship/processors/plantuml-processor.rb
@ -1,25 +1,50 @@
 # frozen_string_literal: true

+require "net/http"
+require "base64"
+
 module Jekyll::Spaceship
-  class PlantUMLProcessor < Processor
+  class PlantumlProcessor < Processor
    exclude :none

-    def on_handle_markdown(content)
-      # match default plantuml block and code block
-      pattern = Regexp.union(
-        /(\\?@startuml((?:.|\n)*?)@enduml)/,
-        /(`{3}\s*plantuml((?:.|\n)*?)`{3})/
-      )
+    def self.config
+      {
+        'mode' => 'default',
+        'syntax' => {
+          'code' => 'plantuml!',
+          'custom' => ['@startuml', '@enduml']
+        },
+        'css' => {
+          'class' => 'plantuml'
+        },
+        'src' => 'http://www.plantuml.com/plantuml/svg/'
+      }
+    end

+    def on_handle_markdown(content)
+      # match custom plantuml block and code block
+      syntax = self.config['syntax']
+      code_name = syntax['code']
+      custom = syntax['custom'][-2, 2]
+
+      patterns = [
+        /((`{3,})\s*#{code_name}((?:.|\n)*?)\2)/,
+        /((?<!\\)(#{custom[0]})((?:.|\n)*?)(?<!\\)(#{custom[1]}))/
+      ]
+
+      patterns.each do |pattern|
+        content = handle_plantuml_block(pattern, content)
+      end
+
+      # handle escape custom plantuml block
+      content.gsub(/\\(#{custom[0]}|#{custom[1]})/, '\1')
+    end
+
+    def handle_plantuml_block(pattern, content)
      content.scan pattern do |match|
        match = match.select { |m| not m.nil? }
        block = match[0]
-        code = match[1]
-
-        # skip escape default plantuml block
-        if block.match(/(^\\@startuml|\\@enduml$)/)
-          next
-        end
+        code = match[2]

        self.handled = true

@ -28,25 +53,41 @@ module Jekyll::Spaceship
          handle_plantuml(code)
        )
      end
-
-      # handle escape default plantuml block
-      content.gsub(/\\(@startuml|@enduml)/, '\1')
+      content
    end

    def handle_plantuml(code)
      # wrap plantuml code
-      uml = "@startuml#{code}@enduml"
+      code = "@startuml#{code}@enduml".encode('UTF-8')
+      url = self.get_url(code)

-      dir = File.dirname(__FILE__)
-      jar = dir + "/../utils/plantuml/plantuml.jar"
-      echo = "echo -e \"#{uml.gsub('"', '\"')}\""
-      plantuml = "java -jar \"#{jar}\" -pipe 2>/dev/null"
-
-      # exec plantuml.jar and output base64 data
-      base64 = `#{echo} | #{plantuml} | base64`
+      # render mode
+      case self.config['mode']
+      when 'pre-fetch'
+        data = self.class.fetch_img_data(url)
+      end
+      if data.nil?
+        data = { 'type' => 'url', 'body' => url }
+      end

      # return img tag
-      "<img src=\"data:image/png;base64, #{base64}\">"
+      data['class'] = self.config['css']['class']
+      self.class.make_img_tag(data)
+    end
+
+    def get_url(code)
+      src = self.config['src']
+
+      # set default method
+      src += '{hexcode}' if src.match(/\{.*\}/).nil?
+
+      # encode to hex string
+      if src.include?('{hexcode}')
+        code = '~h' + code.unpack("H*").first
+        return src.gsub('{hexcode}', code)
+      else
+        raise "No supported src ! #{src}"
+      end
    end
  end
 end
--- a/lib/jekyll-spaceship/processors/table-processor.rb
+++ b/lib/jekyll-spaceship/processors/table-processor.rb
@ -5,18 +5,23 @@ require "nokogiri"

 module Jekyll::Spaceship
  class TableProcessor < Processor
+    ATTR_LIST_PATTERN = /((?<!\\)\{:(?:([A-Za-z]\S*):)?(.*?)(?<!\\)\})/
+    ATTR_LIST_REFS = {}
+
    def on_handle_markdown(content)
      # pre-handle reference-style links
      references = {}
-      content.scan(/(\[(.*)\]:\s*(.*))/) do |match_data|
+      content.scan(/\n\s*(\[(.*)\]:\s*(\S+(\s+".*?")?))/) do |match_data|
        ref_name = match_data[1]
        ref_value = match_data[2]
        references[ref_name] = ref_value
      end
      if references.size > 0
-        content.scan(/.*(?<!\\)\|.*/) do |result|
+        content.scan(/[^\n]*(?<!\\)\|[^\n]*/) do |result|
          references.each do |key, val|
-            replace = result.gsub(/\[(.*)\]\s*\[#{key}\]/, "[\1](#{val})")
+            replace = result.gsub(
+              /\[([^\n\]]*?)\]\s*\[#{key}\]/,
+              "[\1](#{val})")
            next if result == replace
            content = content.gsub(result, replace)
          end
@ -24,21 +29,37 @@ module Jekyll::Spaceship
      end

      # pre-handle row-span
-      content = content.gsub(/(?<!\\)(\|.*\\\s*)\|\s*\n/, "\\1\n")
+      content = content.gsub(/(?<!\\)(\|[^\n]*\\\s*)\|\s*\n/, "\\1\n")

      # escape | and :
      content = content.gsub(/\|(?=\|)/, '\\|')
-        .gsub(/\\:(?=.*?(?<!\\)\|)/, '\\\\\\\\:')
-        .gsub(/((?<!\\)\|.*?)(\\:)/, '\1\\\\\\\\:')
+        .gsub(/\\:(?=[^\n]*?(?<!\\)\|)/, '\\\\\\\\:')
+        .gsub(/((?<!\\)\|[^\n]*?)(\\:)/, '\1\\\\\\\\:')

      # escape * and _ and $ etc.
-      content.scan(/.*(?<!\\)\|.*/) do |result|
+      content.scan(/[^\n]*(?<!\\)\|[^\n]*/) do |result|
+        # skip for math expression within pipeline
+        next unless result
+          .gsub(/((?<!\\)\${1,2})[^\n]*?\1/, '')
+          .match(/(?<!\\)\|/)
        replace = result.gsub(
-          /(?<!(?<!\\)\\)(\*|\$|\[|\(|\"|_)/,
-          '\\\\\\\\\1')
+          /(?<!(?<!\\)\\)(\*|\$|\[|\(|\"|_)/, '\\\\\\\\\1')
        next if result == replace
        content = content.gsub(result, replace)
      end
+
+      # pre-handle attribute list (AL)
+      ATTR_LIST_REFS.clear()
+      content.scan(ATTR_LIST_PATTERN) do |result|
+        ref = result[1]
+        list = result[2]
+        next if ref.nil?
+        if ATTR_LIST_REFS.has_key? ref
+          ATTR_LIST_REFS[ref] += list
+        else
+          ATTR_LIST_REFS[ref] = list
+        end
+      end
      content
    end

@ -46,6 +67,43 @@ module Jekyll::Spaceship
      # use nokogiri to parse html content
      doc = Nokogiri::HTML(content)

+      data = self.table_scope_data
+
+      # handle each table
+      doc.css('table').each do |table|
+        next if table.ancestors('code, pre').size > 0
+        rows = table.css('tr')
+        data.table = table
+        data.rows = rows
+        data.reset.call :table
+        rows.each do |row|
+          cells = row.css('th, td')
+          data.row = row
+          data.cells = cells
+          data.reset.call :row
+          cells.each do |cell|
+            data.cell = cell
+            handle_colspan(data)
+            handle_multi_rows(data)
+            handle_text_align(data)
+            handle_rowspan(data)
+            handle_attr_list(data)
+          end
+        end
+        rows.each do |row|
+          cells = row.css('th, td')
+          cells.each do |cell|
+            data.cell = cell
+            handle_format(data)
+          end
+        end
+        self.handled = true
+      end
+
+      doc.to_html
+    end
+
+    def table_scope_data
      data = OpenStruct.new(_: OpenStruct.new)
      data.reset = ->(scope, namespace = nil) {
        data._.marshal_dump.each do |key, val|
@ -63,78 +121,48 @@ module Jekyll::Spaceship
        end
        data._[namespace]
      }
-
-      # handle each table
-      doc.css('table').each do |table|
-        rows = table.css('tr')
-        data.table = table
-        data.rows = rows
-        data.reset.call :table
-        rows.each do |row|
-          cells = row.css('th, td')
-          data.row = row
-          data.cells = cells
-          data.reset.call :row
-          cells.each do |cell|
-            data.cell = cell
-            handle_colspan(data)
-            handle_multi_rows(data)
-            handle_text_align(data)
-            handle_rowspan(data)
-          end
-        end
-        rows.each do |row|
-          cells = row.css('th, td')
-          cells.each do |cell|
-            data.cell = cell
-            handle_format(data)
-          end
-        end
-        self.handled = true
-      end
-
-      doc.to_html
+      data
    end

    def handle_colspan(data)
      scope = data.scope.call __method__
-      scope_table = scope.table
-      scope_row = scope.row
      cells = data.cells
      cell = data.cell

-      if scope_table.row != data.row
-        scope_table.row = data.row
-        scope_row.colspan = 0
+      if scope.table.row != data.row
+        scope.table.row = data.row
+        scope.row.colspan = 0
      end

      # handle colspan
-      result = cell.content.match(/(\s*\|)+$/)
-      if cell == cells.last and scope_row.colspan > 0
-        range = (cells.count - scope_row.colspan)...cells.count
-        for i in range do
-          cells[i].remove
+      if cell == cells.last and scope.row.colspan > 0
+        cells.count.downto(cells.count - scope.row.colspan + 1) do |i|
+          c = cells[i - 1]
+          return unless c.get_attribute('colspan').nil?
+          c.remove
        end
      end
-      if result
-        result = result[0]
-        scope_row.colspan += result.scan(/\|/).count
-        cell.content = cell.content.gsub(/(\s*\|)+$/, '')
-        cell.set_attribute('colspan', scope_row.colspan + 1)
-      end
+
+      result = cell.content.match(/(\|)+$/)
+      return if result.nil?
+
+      cell.content = cell.content.gsub(/(\|)+$/, '')
+      result = result[0]
+      colspan = result.scan(/\|/).count
+      scope.row.colspan += colspan
+      cell.set_attribute('colspan', colspan + 1)
    end

    def handle_multi_rows(data)
      scope = data.scope.call __method__
-      scope_table = scope.table
      cells = data.cells
      row = data.row
      cell = data.cell

-      if scope_table.table != data.table
-        scope_table.table = data.table
-        scope_table.multi_row_cells = nil
-        scope_table.multi_row_start = false
+      if scope.table.table != data.table
+        scope.table.table = data.table
+        scope.table.multi_row_cells = nil
+        scope.table.multi_row_start = false
      end

      # handle multi-rows
@ -143,53 +171,49 @@ module Jekyll::Spaceship
      match = cell.content.match(/(?<!\\)\\\s*$/)
      if match
        cell.content = cell.content.gsub(/(?<!\\)\\\s*$/, '')
-        if not scope_table.multi_row_start
-          scope_table.multi_row_cells = cells
-          scope_table.multi_row_start = true
+        if not scope.table.multi_row_start
+          scope.table.multi_row_cells = cells
+          scope.table.multi_row_start = true
        end
      end

-      if scope_table.multi_row_cells != cells and scope_table.multi_row_start
-        for i in 0...scope_table.multi_row_cells.count do
-          multi_row_cell = scope_table.multi_row_cells[i]
-          multi_row_cell.content += "  \n#{cells[i].content}"
+      if scope.table.multi_row_cells != cells and scope.table.multi_row_start
+        for i in 0...scope.table.multi_row_cells.count do
+          multi_row_cell = scope.table.multi_row_cells[i]
+          multi_row_cell.inner_html += "\n<br>\n#{cells[i].inner_html}"
        end
        row.remove
      end
-      scope_table.multi_row_start = false if not match
+      scope.table.multi_row_start = false if not match
    end

    def handle_rowspan(data)
      scope = data.scope.call __method__
-      scope_table = scope.table
-      scope_row = scope.row
      cell = data.cell
      cells = data.cells

-      if scope_table.table != data.table
-        scope_table.table = data.table
-        scope_table.span_row_cells = []
+      if scope.table.table != data.table
+        scope.table.table = data.table
+        scope.table.span_row_cells = []
      end
-
-      if scope_row.row != data.row
-        scope_row.row = data.row
-        scope_row.col_index = 0
+      if scope.row.row != data.row
+        scope.row.row = data.row
+        scope.row.col_index = 0
      end

      # handle rowspan
-      span_cell = scope_table.span_row_cells[scope_row.col_index]
+      span_cell = scope.table.span_row_cells[scope.row.col_index]
      if span_cell and cell.content.match(/^\s*\^{2}/)
        cell.content = cell.content.gsub(/^\s*\^{2}/, '')
-        span_cell.content += "  \n#{cell.content}"
+        span_cell.inner_html += "\n<br>\n#{cell.inner_html}"
        rowspan = span_cell.get_attribute('rowspan') || 1
        rowspan = rowspan.to_i + 1
        span_cell.set_attribute('rowspan', "#{rowspan}")
        cell.remove
      else
-        scope_table.span_row_cells[scope_row.col_index] = cell
+        scope.table.span_row_cells[scope.row.col_index] = cell
      end
-
-      scope_row.col_index += 1
+      scope.row.col_index += [cell.get_attribute('colspan').to_i, 1].max
    end

    def handle_text_align(data)
@ -206,12 +230,12 @@ module Jekyll::Spaceship
        align += 2
      end

-      # handle escape colon
-      cell.content = cell.content.gsub(/\\:/, ':')
-
      # handle text align
      return if align == 0

+      # handle escape colon
+      cell.content = cell.content.gsub(/\\:/, ':')
+
      style = cell.get_attribute('style')
      if align == 1
        align = 'text-align: left'
@ -230,13 +254,69 @@ module Jekyll::Spaceship
      cell.set_attribute('style', style)
    end

+    # Examples:
+    # {:ref-name: .cls1 title="hello" }
+    # {: #id ref-name data="world" }
+    # {: #id title="hello" }
+    # {: .cls style="color: #333" }
+    def handle_attr_list(data)
+      cell = data.cell
+      content = cell.inner_html
+      # inline attribute list(IAL) handler
+      ial_handler = ->(list) do
+        list.scan(/(\S+)=("|')(.*?)\2|(\S+)/) do |attr|
+          key = attr[0]
+          val = attr[2]
+          single = attr[3]
+          if !key.nil?
+            val = (cell.get_attribute(key) || '') + val
+            cell.set_attribute(key, val)
+          elsif !single.nil?
+            if single.start_with? '#'
+              key = 'id'
+              val = single[1..-1]
+            elsif single.start_with? '.'
+              key = 'class'
+              val = cell.get_attribute(key) || ''
+              val += (val.size.zero? ? '' : ' ') + single[1..-1]
+            elsif ATTR_LIST_REFS.has_key? single
+              ial_handler.call ATTR_LIST_REFS[single]
+            end
+            unless key.nil?
+              cell.set_attribute(key, val)
+            end
+          end
+        end
+      end
+      # handle attribute list
+      content.scan(ATTR_LIST_PATTERN) do |result|
+        ref = result[1]
+        list = result[2]
+        # handle inline attribute list
+        ial_handler.call list if ref.nil?
+        # remove attr_list
+        content = content.sub(result[0], '')
+      end
+      cell.inner_html = content
+    end
+
    def handle_format(data)
      cell = data.cell
      cvter = self.converter('markdown')
      return if cvter.nil?
-      content = cell.content.gsub(/(?<!\\)\|/, '\\|')
-      content = cvter.convert(content.strip)
-      cell.inner_html = Nokogiri::HTML.fragment(content)
+      content = cell.inner_html
+      content = self.pre_exclude(content, [/(\<code.*\>.*\<\/code\>)/])
+        .gsub(/(?<!\\)\|/, '\\|')
+        .gsub(/^\s+|\s+$/, '')
+        .gsub(/&lt;/, '<')
+        .gsub(/&gt;/, '>')
+      content = self.post_exclude(content)
+      content = cvter.convert(content)
+      content = Nokogiri::HTML.fragment(content)
+      if content.children.first&.name == 'p'
+        content = content.children
+      end
+      cell.inner_html = content.inner_html
    end
  end
 end
--- a/lib/jekyll-spaceship/processors/video-processor.rb
+++ b/lib/jekyll-spaceship/processors/video-processor.rb
@ -1,99 +0,0 @@
-# frozen_string_literal: true
-
-module Jekyll::Spaceship
-  class VideoProcessor < Processor
-    def on_handle_markdown(content)
-      content = handle_youtube(content)
-      content = handle_vimeo(content)
-      content = handle_dailymotion(content)
-    end
-
-    # Examples:
-    # ![youtube](https://www.youtube.com/watch?v=XA2WjJbmmoM "title")
-    # ![youtube](http://www.youtube.com/embed/w-m_yZCLF5Q)
-    # ![youtube](//youtu.be/mEP3YXaSww8?height=100%&width=400)
-    def handle_youtube(content)
-      handle_video(content, {
-        host: '(https?:)?\\/\\/.*youtu.*',
-        id: '(?<=\\?v\\=|embed\\/|\\.be\\/)([a-zA-Z0-9\\_\\-]+)',
-        iframe_url: "https://www.youtube.com/embed/"
-      })
-    end
-
-    # Examples:
-    # ![vimeo](https://vimeo.com/263856289)
-    # ![vimeo](https://vimeo.com/263856289?height=100%&width=400)
-    def handle_vimeo(content)
-      handle_video(content, {
-        host: '(https?:)?\\/\\/vimeo\\.com\\/',
-        id: '([0-9]+)',
-        iframe_url: "https://player.vimeo.com/video/",
-        width: 600,
-        height: 350
-      })
-    end
-
-    # Examples:
-    # ![dailymotion](https://www.dailymotion.com/video/x7tgcev)
-    # ![dailymotion](https://dai.ly/x7tgcev?height=100%&width=400)
-    def handle_dailymotion(content)
-      handle_video(content, {
-        host: '(https?:)?\\/\\/.*dai.?ly.*',
-        id: '(?<=video\\/|\\/)([a-zA-Z0-9\\_\\-]+)',
-        iframe_url: "https://www.dailymotion.com/embed/video/"
-      })
-    end
-
-    def handle_video(content, data)
-      host = data[:host]
-      return content if content.sub(/#{host}/, '').nil?
-
-      iframe_url = data[:iframe_url]
-      id = data[:id]
-      url = "(#{host}#{id}\\S*)"
-      title = '("(.*)".*){0,1}'
-
-      # pre-handle reference-style links
-      regex = /(\[(.*)\]:\s*(#{url}\s*#{title}))/
-      content.scan regex do |match_data|
-        match = match_data[0]
-        ref_name = match_data[1]
-        ref_value = match_data[2]
-        content = content.gsub(match, '')
-          .gsub(/\!\[(.*)\]\s*\[#{ref_name}\]/,
-            "![\1](#{ref_value})")
-      end
-
-      # handle inline-style links
-      regex = /(\!\[(.*)\]\(.*#{url}\s*#{title}\))/
-      content.scan regex do |match_data|
-        url = match_data[2]
-        id = match_data[4]
-        title = match_data[6]
-        width = url.match(/(?<=width=)(\S*?)(?=&|$)/)
-        height = url.match(/(?<=height=)(\S*?)(?=&|$)/)
-
-        data[:width] = 600 if data[:width].nil?
-        data[:height] = 400 if data[:height].nil?
-        style = "max-width: 100%" if width.nil?
-        width = data[:width] if width.nil?
-        height = data[:height] if height.nil?
-
-        url = "#{iframe_url}#{id}"
-        html = "<iframe \
-          src=\"#{url}\" \
-          title=\"#{title}\" \
-          width=\"#{width}\" \
-          height=\"#{height}\" \
-          style=\"#{style}\" \
-          frameborder=\"0\" \
-          allowfullscreen=\"\">\
-          </iframe>"
-
-        content = content.gsub(match_data[0], html)
-        self.handled = true
-      end
-      content
-    end
-  end
-end
--- a/lib/jekyll-spaceship/utils/.keep
+++ b/lib/jekyll-spaceship/utils/.keep
--- a/lib/jekyll-spaceship/utils/plantuml/plantuml.jar
+++ b/lib/jekyll-spaceship/utils/plantuml/plantuml.jar
--- a/lib/jekyll-spaceship/version.rb
+++ b/lib/jekyll-spaceship/version.rb
@ -2,6 +2,6 @@

 module Jekyll
  module Spaceship
-    VERSION = "0.4.2"
+    VERSION = "0.9.3"
  end
 end
--- a/logos/jekyll-spaceship-logo.png
+++ b/logos/jekyll-spaceship-logo.png
--- a/spec/spec_helper.rb
+++ b/spec/spec_helper.rb
@ -0,0 +1,100 @@
+# This file was generated by the `rspec --init` command. Conventionally, all
+# specs live under a `spec` directory, which RSpec adds to the `$LOAD_PATH`.
+# The generated `.rspec` file contains `--require spec_helper` which will cause
+# this file to always be loaded, without a need to explicitly require it in any
+# files.
+#
+# Given that it is always loaded, you are encouraged to keep this file as
+# light-weight as possible. Requiring heavyweight dependencies from this file
+# will add to the boot time of your test suite on EVERY test run, even for an
+# individual file that may not need all of that loaded. Instead, consider making
+# a separate helper file that requires the additional dependencies and performs
+# the additional setup, and require it from the spec files that actually need
+# it.
+#
+# See http://rubydoc.info/gems/rspec-core/RSpec/Core/Configuration
+RSpec.configure do |config|
+  # rspec-expectations config goes here. You can use an alternate
+  # assertion/expectation library such as wrong or the stdlib/minitest
+  # assertions if you prefer.
+  config.expect_with :rspec do |expectations|
+    # This option will default to `true` in RSpec 4. It makes the `description`
+    # and `failure_message` of custom matchers include text for helper methods
+    # defined using `chain`, e.g.:
+    #     be_bigger_than(2).and_smaller_than(4).description
+    #     # => "be bigger than 2 and smaller than 4"
+    # ...rather than:
+    #     # => "be bigger than 2"
+    expectations.include_chain_clauses_in_custom_matcher_descriptions = true
+  end
+
+  # rspec-mocks config goes here. You can use an alternate test double
+  # library (such as bogus or mocha) by changing the `mock_with` option here.
+  config.mock_with :rspec do |mocks|
+    # Prevents you from mocking or stubbing a method that does not exist on
+    # a real object. This is generally recommended, and will default to
+    # `true` in RSpec 4.
+    mocks.verify_partial_doubles = true
+  end
+
+  # This option will default to `:apply_to_host_groups` in RSpec 4 (and will
+  # have no way to turn it off -- the option exists only for backwards
+  # compatibility in RSpec 3). It causes shared context metadata to be
+  # inherited by the metadata hash of host groups and examples, rather than
+  # triggering implicit auto-inclusion in groups with matching metadata.
+  config.shared_context_metadata_behavior = :apply_to_host_groups
+
+# The settings below are suggested to provide a good initial experience
+# with RSpec, but feel free to customize to your heart's content.
+=begin
+  # This allows you to limit a spec run to individual examples or groups
+  # you care about by tagging them with `:focus` metadata. When nothing
+  # is tagged with `:focus`, all examples get run. RSpec also provides
+  # aliases for `it`, `describe`, and `context` that include `:focus`
+  # metadata: `fit`, `fdescribe` and `fcontext`, respectively.
+  config.filter_run_when_matching :focus
+
+  # Allows RSpec to persist some state between runs in order to support
+  # the `--only-failures` and `--next-failure` CLI options. We recommend
+  # you configure your source control system to ignore this file.
+  config.example_status_persistence_file_path = "spec/examples.txt"
+
+  # Limits the available syntax to the non-monkey patched syntax that is
+  # recommended. For more details, see:
+  #   - http://rspec.info/blog/2012/06/rspecs-new-expectation-syntax/
+  #   - http://www.teaisaweso.me/blog/2013/05/27/rspecs-new-message-expectation-syntax/
+  #   - http://rspec.info/blog/2014/05/notable-changes-in-rspec-3/#zero-monkey-patching-mode
+  config.disable_monkey_patching!
+
+  # This setting enables warnings. It's recommended, but in some cases may
+  # be too noisy due to issues in dependencies.
+  config.warnings = true
+
+  # Many RSpec users commonly either run the entire suite or an individual
+  # file, and it's useful to allow more verbose output when running an
+  # individual spec file.
+  if config.files_to_run.one?
+    # Use the documentation formatter for detailed output,
+    # unless a formatter has already been configured
+    # (e.g. via a command-line flag).
+    config.default_formatter = "doc"
+  end
+
+  # Print the 10 slowest examples and example groups at the
+  # end of the spec run, to help surface which specs are running
+  # particularly slow.
+  config.profile_examples = 10
+
+  # Run specs in random order to surface order dependencies. If you find an
+  # order dependency and want to debug it, you can fix the order by providing
+  # the seed, which is printed after each run.
+  #     --seed 1234
+  config.order = :random
+
+  # Seed global randomization in this process using the `--seed` CLI option.
+  # Setting this allows you to use `--seed` to deterministically reproduce
+  # test failures related to randomization by passing the same `--seed` value
+  # as the one that triggered the failure.
+  Kernel.srand config.seed
+=end
+end
Author	SHA1	Message	Date
jeffreytse	8ca6d144a4	release: v0.9.3	2020-10-07 18:46:06 +08:00
jeffreytse	7847cac8c4	fix: inline code corrupted in table (#27 )	2020-10-07 18:41:45 +08:00
jeffreytse	6973d6ab7e	docs: update README.md	2020-10-03 09:22:31 +08:00
jeffreytse	ac287926a9	release: v0.9.2	2020-09-18 12:35:17 +08:00
jeffreytse	4195a431be	docs: update README.md	2020-09-16 18:40:38 +08:00
jeffreytse	e1a5bf7356	feat: support svg object for diagrams (#23,#24,#25)	2020-09-16 18:38:26 +08:00
jeffreytse	b29469b7b2	feat: add images related functions	2020-09-16 18:33:47 +08:00
jeffreytse	7d86dcbe03	docs: update README.md	2020-08-29 20:11:00 +08:00
jeffreytse	793e6591a3	chore: revise .travis.yml format	2020-08-29 20:08:23 +08:00
Dirk van Oosterbosch	9b283f62e5	docs: revise the link to the PlantUML website (#22 )	2020-08-28 18:12:27 +08:00
jeffreytse	ccd9c971c1	chore: init rspec	2020-08-16 17:30:23 +08:00
jeffreytse	c15932fd45	chore: update gemspec summary	2020-08-10 16:29:48 +08:00
jeffreytse	d0e4f6d9aa	release: v0.9.1	2020-08-10 16:27:34 +08:00
jeffreytse	643072fdf3	docs: update README.md	2020-08-10 16:24:28 +08:00
jeffreytse	92ee45f8b2	feat: support spotify and soundcloud	2020-08-10 11:52:51 +08:00
jeffreytse	c596868051	refactor: rename video-processor to media-processor	2020-08-09 19:06:09 +08:00
jeffreytse	de62d61a6a	feat: support rendering audio link	2020-08-09 19:04:29 +08:00
jeffreytse	3852a48aba	docs: update README.md	2020-08-01 11:31:24 +08:00
jeffreytse	9b7ed3a951	release: v0.9.0	2020-08-01 11:30:59 +08:00
jeffreytse	2fa6177694	feat: support mathjax v3	2020-08-01 11:22:42 +08:00
jeffreytse	c98006df64	fix: liquid filter of percent form broken (#21 )	2020-07-31 21:18:16 +08:00
jeffreytse	c59b4e67f5	release: v0.8.7	2020-07-30 12:29:30 +08:00
jeffreytse	58b9d5e784	fix: wrong ext matched if path including dots	2020-07-30 12:25:48 +08:00
jeffreytse	d094789ad4	fix: link and image in same row not working (#20 )	2020-07-28 11:59:32 +08:00
jeffreytse	f8f6ffe26e	docs: update README.md	2020-07-26 01:05:18 +08:00
jeffreytse	44ec868188	release: v0.8.6	2020-07-26 00:47:40 +08:00
jeffreytse	2e99bcfb84	docs: update README.md	2020-07-26 00:43:56 +08:00
jeffreytse	04ff451208	feat: support table cell attribute list (#19 )	2020-07-25 20:54:31 +08:00
jeffreytse	a85ec310cd	fix: html inside table cell not working	2020-07-25 14:09:27 +08:00
jeffreytse	c916d10c6b	release: v0.8.5	2020-07-21 10:30:25 +08:00
jeffreytse	430b992521	fix: error with permalink file extension (#18 )	2020-07-21 10:23:25 +08:00
jeffreytse	e1f1aa9006	release: v0.8.4	2020-07-16 13:54:47 +08:00
jeffreytse	6d3bd946f2	fix: liquid filter tag broken issue	2020-07-16 13:05:04 +08:00
jeffreytse	8e932a4d32	fix: correct style of table cell	2020-07-16 13:00:35 +08:00
jeffreytse	006983a62e	fix: emoji img css class and block display issue	2020-07-09 23:07:13 +08:00
jeffreytse	59d47ecbc8	release: v0.8.3	2020-07-04 11:39:18 +08:00
jeffreytse	4c07bdcd8d	docs: update README.md	2020-07-04 11:36:18 +08:00
jeffreytse	a3a1cc2b88	fix: math expression within pipline broken (#14 )	2020-07-03 13:00:32 +08:00
jeffreytse	68cc44e2bd	release: v0.8.2	2020-07-02 15:48:46 +08:00
jeffreytse	53a203ff66	fix: math expression with pipeline not working	2020-07-02 15:45:09 +08:00
jeffreytse	40103470cd	perf: match markdown table more exactly	2020-07-02 15:42:54 +08:00
jeffreytse	bf641a67f6	fix: table in code or pre html tag not skipped	2020-07-01 23:46:56 +08:00
jeffreytse	7b31d51d88	refactor: better maintainability	2020-06-28 12:28:40 +08:00
jeffreytse	686e24b634	release: v0.8.1	2020-06-25 12:29:05 +08:00
jeffreytse	a1810890e5	docs: update README.md	2020-06-24 14:46:29 +08:00
jeffreytse	137a0bafbf	fix: css id and class with video id not working	2020-06-24 14:29:38 +08:00
jeffreytse	21e4435a74	docs: update README.md	2020-06-23 09:56:43 +08:00
jeffreytse	724e20e1a9	release: v0.8.0	2020-06-22 23:10:16 +08:00
jeffreytse	afce6b2191	chore: update gemspec summary	2020-06-22 23:07:44 +08:00
jeffreytse	ed231ba8c2	chore: change default syntax of code block	2020-06-22 23:03:49 +08:00
jeffreytse	a6842ffa27	docs: update README.md	2020-06-22 22:54:43 +08:00
jeffreytse	e1dbca31a0	refactor: revise pre-fetch mode of plantuml	2020-06-22 18:44:45 +08:00
jeffreytse	7e495e9468	refactor: revise pre-fetch mode of mermaid	2020-06-22 18:43:40 +08:00
jeffreytse	a3cc560007	feat: add mermaid-processor to default config	2020-06-22 18:07:11 +08:00
jeffreytse	425f90cdaf	feat: add mermaid processor	2020-06-22 18:06:50 +08:00
jeffreytse	5f3f23dcb9	feat: add flexible config for emoji processor	2020-06-22 18:05:30 +08:00
jeffreytse	d553212c84	feat: add flexible config for video processor	2020-06-22 18:05:03 +08:00
jeffreytse	7b6cf5d5db	feat: add flexible config for plantuml processor	2020-06-22 18:04:06 +08:00
jeffreytse	71563cceb6	release: v0.7.3	2020-06-22 12:31:53 +08:00
jeffreytse	a30d7e46f0	fix: load site config broke in group plugins (#12 )	2020-06-22 12:16:02 +08:00
jeffreytse	b3b7d1fb15	release: v0.7.2	2020-06-21 22:34:51 +08:00
jeffreytse	5b1b41889c	fix: processor default config not working	2020-06-21 22:31:59 +08:00
jeffreytse	36a58e6ab8	chore: remove unused yaml requirement	2020-06-21 18:00:19 +08:00
jeffreytse	bfcd31a493	release: v0.7.1	2020-06-19 02:04:20 +08:00
jeffreytse	ed78592816	fix: specify config files not working (#11 )	2020-06-19 01:58:55 +08:00
jeffreytse	6f5a0b6912	docs: update README.md	2020-06-15 13:42:14 +08:00
jeffreytse	7b11b0a854	release: v0.7.0	2020-06-15 01:14:36 +08:00
jeffreytse	b47c942d0a	docs: update README.md	2020-06-15 01:13:47 +08:00
jeffreytse	512b9a89ed	fix: empty element and regex matching issue	2020-06-14 23:17:15 +08:00
jeffreytse	afd203b121	feat: add element-processor to default config	2020-06-14 22:48:36 +08:00
jeffreytse	4c26f25f7c	feat: add element processor	2020-06-14 22:46:39 +08:00
jeffreytse	0d82237ad8	fix: merging default config issue	2020-06-14 22:41:57 +08:00
jeffreytse	f175be2b49	release: v0.6.3	2020-06-14 03:54:20 +08:00
jeffreytse	c1187eb633	fix: escape code block issue (#10 )	2020-06-14 03:51:20 +08:00
jeffreytse	098ed91509	perfect: improve plantuml code block compatibility	2020-06-14 03:49:17 +08:00
jeffreytse	6a12fa7c95	feat: add default max width of video	2020-06-14 01:58:54 +08:00
jeffreytse	3fb0fa35d1	docs: update README.md	2020-06-13 21:21:42 +08:00
jeffreytse	4b9291d137	release: v0.6.2	2020-06-13 18:16:59 +08:00
jeffreytse	c1033d3b97	chore: update gemspec summary	2020-06-13 18:15:05 +08:00
jeffreytse	bb29d05f9b	feat: support normal videos	2020-06-13 18:12:45 +08:00
jeffreytse	f5e26a0549	chore: revise emoji img tag	2020-06-13 18:02:11 +08:00
jeffreytse	72dfb0fbec	perfect: refine config granularity	2020-06-13 16:06:05 +08:00
jeffreytse	9e63239cb0	feat: better video attributes	2020-06-13 15:36:45 +08:00
jeffreytse	959311a89b	fix: collections are not treated (#8 )	2020-06-13 15:08:19 +08:00
jeffreytse	9f41aa9f65	release: v0.6.1	2020-06-10 22:36:03 +08:00
jeffreytse	c553ccf07f	fix: the cell content rendering is corrupt (#9 )	2020-06-10 22:07:12 +08:00
jeffreytse	b60dc56a21	docs: update README.md	2020-05-26 14:12:03 +08:00
jeffreytse	cf8171465a	release: v0.6.0	2020-05-26 13:44:48 +08:00
jeffreytse	71e58aaa54	feat: add config for processor	2020-05-26 13:38:48 +08:00
jeffreytse	68f69a9ffe	feat: use processors by config	2020-05-26 13:38:32 +08:00
jeffreytse	627aeb4ff4	feat: add config core	2020-05-26 13:37:25 +08:00
jeffreytse	76f00f37dc	docs: update README.md	2020-05-25 21:00:30 +08:00
jeffreytse	496ffb9294	release: v0.5.4	2020-05-21 15:26:26 +08:00
jeffreytse	9da37027fe	feat: add class name for html tag	2020-05-21 15:19:33 +08:00
jeffreytse	deb98c7ed5	refactor: perfect emoji processor	2020-05-21 15:18:48 +08:00
jeffreytse	22f485381e	fix: html entities issue	2020-05-21 15:16:29 +08:00
jeffreytse	64b06a6d24	fix: colspan feature is not working (#6 )	2020-05-21 12:41:16 +08:00
jeffreytse	5c928bf781	ci: update travis.yml	2020-05-20 03:57:51 +08:00
jeffreytse	c563485ef2	release: v0.5.3	2020-05-20 03:47:01 +08:00
jeffreytse	5c3a2b2ce8	fix: the array method params issue	2020-05-20 03:44:58 +08:00
jeffreytse	5e3fe1639f	release: v0.5.2	2020-05-19 19:38:11 +08:00
jeffreytse	6c5fa22898	perf: render plantuml on server side	2020-05-19 19:33:17 +08:00
jeffreytse	fe53c63d50	docs: update README.md	2020-05-19 12:17:01 +08:00
jeffreytse	76a96c3a4e	release: v0.5.1	2020-05-18 23:47:28 +08:00
jeffreytse	006db3bbcd	feat: styling terminal info output	2020-05-18 23:44:49 +08:00
jeffreytse	3feff20e20	chore: correct variable name	2020-05-18 12:46:35 +08:00
jeffreytse	24b9800405	fix: table cell colspan issue	2020-05-18 03:04:40 +08:00
jeffreytse	768cd1b73e	release: v0.5.0	2020-05-17 20:04:00 +08:00
jeffreytse	c79f3fee55	feat: show unicode emoji when image error	2020-05-17 02:31:27 +08:00
jeffreytse	fd5c0c5a71	docs: update README.md	2020-05-16 20:30:27 +08:00
jeffreytse	4072a420e7	feat: add emoji processor for emoji markup	2020-05-16 19:51:06 +08:00
jeffreytse	0b8603048b	perfect: logger and processor core	2020-05-16 18:10:14 +08:00
jeffreytse	d8ecaf1b25	docs: update README.md	2020-05-16 15:33:07 +08:00
jeffreytse	0605f213e4	chore: update FUNDING.yml	2020-05-16 15:09:48 +08:00
jeffreytse	5c075b4b6c	docs: update README.md	2020-05-16 14:07:45 +08:00
jeffreytse	8ee3977b40	chore: update FUNDING.yml	2020-05-16 13:45:12 +08:00
jeffreytse	74d4a86219	docs: update README.md	2020-05-16 12:01:00 +08:00
jeffreytse	e7400fdb04	feat: support video autoplay in query string	2020-05-16 11:58:12 +08:00
jeffreytse	68cd5108db	fix: interactions between colspan and rowspan (#5 )	2020-05-15 23:58:44 +08:00
jeffreytse	12338ad541	chore: add github FUNDING.yml	2020-05-15 22:29:45 +08:00
jeffreytse	6c603374c8	chore: update jekyll-spaceship logo	2020-05-15 22:14:28 +08:00
jeffreytse	be170568de	docs: update README.md	2020-05-15 22:08:42 +08:00
jeffreytse	7b13e57324	feat: add jekyll-spaceship logo	2020-05-15 20:39:14 +08:00
jeffreytse	791afd0ab9	chore: revise the table colspan code	2020-05-15 18:01:56 +08:00
jeffreytse	6f5add9f8f	release: v0.4.4	2020-05-15 02:23:57 +08:00
Will Fletcher	c5644ecba5	fix: multiple colspans within same row (#4 ) * Fix multiple colspans within same row This fixes a problem whereby each spanning cell in \| spancell1 \|\| spancell2 \|\| cell \| spancell3 \|\| would get progressively larger instead of all spanning their intended number of cells. Resolved by maintaining a count per cell as well as a row-wide count for removing trailing cells. * refactor: revise the colspan counting code Co-authored-by: jeffreytse <jeffreytse.mail@gmail.com>	2020-05-15 02:12:09 +08:00
jeffreytse	5f98b542ba	docs: update README.md	2020-05-14 18:41:59 +08:00
jeffreytse	4e2b64bbca	release: v0.4.3	2020-05-14 10:39:19 +08:00
jeffreytse	045efd3de1	fix: text in paranthesis become interpreted (#3 )	2020-05-14 10:35:59 +08:00
jeffreytse	cf97ad8d1d	chore: revise table processor	2020-05-01 14:47:57 +08:00
jeffreytse	f961be49e8	feat: add codeclimate.yml	2020-05-01 14:44:37 +08:00
jeffreytse	7624339b1d	refactor: improve processor core	2020-05-01 11:48:23 +08:00
jeffreytse	dd679fd4f7	ci: add configration for gem deployment	2020-04-29 17:32:15 +08:00